data_bmse010140 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010140 _Entry.Title lignin_cw_compound_213 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_213 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010140 2 Tracey Duch ? ? bmse010140 3 John Ralph ? ? bmse010140 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010140 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010140 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 81 bmse010140 "1H chemical shifts" 32 bmse010140 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010140 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010140 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010140 4 2011-12-08 2011-12-08 update BMRB ; Changing chemcomp name from Syringylgycerol-B-vanillyl alcohol ether tetra-acetate for database consistency ; bmse010140 5 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010140 6 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010140 7 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010140 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010140 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010140 1 2 John Ralph ? ? ? bmse010140 1 3 Larry Landucci ? L. ? bmse010140 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010140 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_213 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_213 1 $lignin_cw_compound_213 yes native no no ? ? ? bmse010140 1 stop_ save_ save_lignin_cw_compound_213 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_213 _Entity.Entry_ID bmse010140 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'Syringylgycerol-B-vanillyl alcohol ether tetra-acetate' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010140 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010140 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_213 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010140 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010140 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_213 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010140 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010140 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_213 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C27H32O12/c1-15(28)35-13-19-8-9-21(22(10-19)32-5)39-25(14-36-16(2)29)26(37-17(3)30)20-11-23(33-6)27(38-18(4)31)24(12-20)34-7/h8-12,25-26H,13-14H2,1-7H3 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C27 H32 O12' _Chem_comp.Formula_weight 548.53578 _Chem_comp.Formula_mono_iso_wt_nat 548.1893764924 _Chem_comp.Formula_mono_iso_wt_13C 575.279957113 _Chem_comp.Formula_mono_iso_wt_15N 548.1893764924 _Chem_comp.Formula_mono_iso_wt_13C_15N 575.279957113 _Chem_comp.Image_file_name standards/lignin_cw_compound_213/lit/jr_213.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_213/lit/jr_213.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "Syringylgycerol-B-vanillyl alcohol ether tetra-acetate" synonym bmse010140 1 1-(4-acetoxy-3,5-dimethoxyphenyl)-1,3-diacetoxy-2-[4-(1-acetoxymethyl)-2-methoxyphenoxy] synonym bmse010140 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "Syringylgycerol-B-vanillyl alcohol ether tetra-acetate" Beilstein bmse010140 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CC(=O)OCC1=CC(=C(C=C1)OC(COC(C)=O)C(C2=CC(=C(C(=C2)OC)OC(C)=O)OC)OC(C)=O)OC bmse010140 1 Isomeric CC(=O)OCC1=CC(=C(C=C1)OC(COC(C)=O)C(C2=CC(=C(C(=C2)OC)OC(C)=O)OC)OC(C)=O)OC bmse010140 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 AcMe C ? ? ? ? 427.4208 302.0000 ? ? ? bmse010140 1 C2 AcMe C ? ? ? ? 344.2816 222.0000 ? ? ? bmse010140 1 C3 AcMe C ? ? ? ? 150.2912 270.0000 ? ? ? bmse010140 1 C4 AcMe C ? ? ? ? 178.0064 30.0000 ? ? ? bmse010140 1 C5 BOMe C ? ? ? ? 233.4304 350.0000 ? ? ? bmse010140 1 C6 AOMe C ? ? ? ? 288.8576 126.0000 ? ? ? bmse010140 1 C7 AOMe C ? ? ? ? 122.5792 126.0000 ? ? ? bmse010140 1 C8 B6 C ? ? ? ? 316.5696 270.0000 ? ? ? bmse010140 1 C9 B5 C ? ? ? ? 288.8576 254.0000 ? ? ? bmse010140 1 C10 B2 C ? ? ? ? 288.8576 318.0000 ? ? ? bmse010140 1 C11 A2 C ? ? ? ? 233.4304 158.0000 ? ? ? bmse010140 1 C12 A6 C ? ? ? ? 178.0064 158.0000 ? ? ? bmse010140 1 C13 BA C ? ? ? ? 344.2816 318.0000 ? ? ? bmse010140 1 C14 G C ? ? ? ? 261.1424 206.0000 ? ? ? bmse010140 1 C15 BAAcC=O C ? ? ? ? 399.7088 318.0000 ? ? ? bmse010140 1 C16 GAcC=O C ? ? ? ? 316.5696 206.0000 ? ? ? bmse010140 1 C17 AAcC=O C ? ? ? ? 178.0064 254.0000 ? ? ? bmse010140 1 C18 A4AcC=O C ? ? ? ? 178.0064 62.0000 ? ? ? bmse010140 1 C19 B1 C ? ? ? ? 316.5696 302.0000 ? ? ? bmse010140 1 C20 A1 C ? ? ? ? 205.7184 174.0000 ? ? ? bmse010140 1 C21 B4 C ? ? ? ? 261.1424 270.0000 ? ? ? bmse010140 1 C22 B3 C ? ? ? ? 261.1424 302.0000 ? ? ? bmse010140 1 C23 A3 C ? ? ? ? 233.4304 126.0000 ? ? ? bmse010140 1 C24 A5 C ? ? ? ? 178.0064 126.0000 ? ? ? bmse010140 1 C25 B C ? ? ? ? 233.4304 222.0000 ? ? ? bmse010140 1 C26 A C ? ? ? ? 205.7184 206.0000 ? ? ? bmse010140 1 C27 A4 C ? ? ? ? 205.7184 110.0000 ? ? ? bmse010140 1 O28 ? O ? ? ? ? 399.7088 350.0000 ? ? ? bmse010140 1 O29 ? O ? ? ? ? 316.5696 174.0000 ? ? ? bmse010140 1 O30 ? O ? ? ? ? 205.7184 270.0000 ? ? ? bmse010140 1 O31 ? O ? ? ? ? 150.2912 78.0000 ? ? ? bmse010140 1 O32 ? O ? ? ? ? 233.4304 318.0000 ? ? ? bmse010140 1 O33 ? O ? ? ? ? 261.1424 110.0000 ? ? ? bmse010140 1 O34 ? O ? ? ? ? 150.2912 110.0000 ? ? ? bmse010140 1 O35 ? O ? ? ? ? 371.9936 302.0000 ? ? ? bmse010140 1 O36 ? O ? ? ? ? 288.8576 222.0000 ? ? ? bmse010140 1 O37 ? O ? ? ? ? 178.0064 222.0000 ? ? ? bmse010140 1 O38 ? O ? ? ? ? 205.7184 78.0000 ? ? ? bmse010140 1 O39 ? O ? ? ? ? 233.4304 254.0000 ? ? ? bmse010140 1 H40 AcMe H ? ? ? ? 417.5006 284.8182 ? ? ? bmse010140 1 H41 AcMe H ? ? ? ? 444.6026 292.0798 ? ? ? bmse010140 1 H42 AcMe H ? ? ? ? 437.3410 319.1818 ? ? ? bmse010140 1 H43 AcMe H ? ? ? ? 354.2018 204.8182 ? ? ? bmse010140 1 H44 AcMe H ? ? ? ? 361.4634 231.9202 ? ? ? bmse010140 1 H45 AcMe H ? ? ? ? 334.3614 239.1818 ? ? ? bmse010140 1 H46 AcMe H ? ? ? ? 160.2106 287.1823 ? ? ? bmse010140 1 H47 AcMe H ? ? ? ? 133.1089 279.9194 ? ? ? bmse010140 1 H48 AcMe H ? ? ? ? 140.3718 252.8177 ? ? ? bmse010140 1 H49 A4AcMe H ? ? ? ? 158.1664 30.0000 ? ? ? bmse010140 1 H50 A4AcMe H ? ? ? ? 178.0064 10.1600 ? ? ? bmse010140 1 H51 A4AcMe H ? ? ? ? 197.8464 30.0000 ? ? ? bmse010140 1 H52 BOMe H ? ? ? ? 253.2704 350.0000 ? ? ? bmse010140 1 H53 BOMe H ? ? ? ? 233.4304 369.8400 ? ? ? bmse010140 1 H54 BOMe H ? ? ? ? 213.5904 350.0000 ? ? ? bmse010140 1 H55 AOMe H ? ? ? ? 298.7769 108.8177 ? ? ? bmse010140 1 H56 AOMe H ? ? ? ? 306.0399 135.9194 ? ? ? bmse010140 1 H57 AOMe H ? ? ? ? 278.9383 143.1823 ? ? ? bmse010140 1 H58 AOMe H ? ? ? ? 132.4994 143.1818 ? ? ? bmse010140 1 H59 AOMe H ? ? ? ? 105.3974 135.9202 ? ? ? bmse010140 1 H60 AOMe H ? ? ? ? 112.6590 108.8182 ? ? ? bmse010140 1 H61 B6 H ? ? ? ? 333.7516 260.0801 ? ? ? bmse010140 1 H62 B5 H ? ? ? ? 288.8581 234.1600 ? ? ? bmse010140 1 H63 B2 H ? ? ? ? 288.8581 337.8400 ? ? ? bmse010140 1 H64 A2 H ? ? ? ? 250.6124 167.9199 ? ? ? bmse010140 1 H65 A6 H ? ? ? ? 160.8244 167.9199 ? ? ? bmse010140 1 H66 BA H ? ? ? ? 357.0345 333.1983 ? ? ? bmse010140 1 H67 BA H ? ? ? ? 331.5286 333.1983 ? ? ? bmse010140 1 H68 G1 H ? ? ? ? 248.3892 190.8019 ? ? ? bmse010140 1 H69 G2 H ? ? ? ? 273.8949 190.8013 ? ? ? bmse010140 1 H70 B H ? ? ? ? 250.6124 231.9199 ? ? ? bmse010140 1 H71 A H ? ? ? ? 188.5364 196.0801 ? ? ? bmse010140 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010140 1 C2 C2 BMRB bmse010140 1 C3 C3 BMRB bmse010140 1 C4 C4 BMRB bmse010140 1 C5 C5 BMRB bmse010140 1 C6 C6 BMRB bmse010140 1 C7 C7 BMRB bmse010140 1 C8 C8 BMRB bmse010140 1 C9 C9 BMRB bmse010140 1 C10 C10 BMRB bmse010140 1 C11 C11 BMRB bmse010140 1 C12 C12 BMRB bmse010140 1 C13 C13 BMRB bmse010140 1 C14 C14 BMRB bmse010140 1 C15 C15 BMRB bmse010140 1 C16 C16 BMRB bmse010140 1 C17 C17 BMRB bmse010140 1 C18 C18 BMRB bmse010140 1 C19 C19 BMRB bmse010140 1 C20 C20 BMRB bmse010140 1 C21 C21 BMRB bmse010140 1 C22 C22 BMRB bmse010140 1 C23 C23 BMRB bmse010140 1 C24 C24 BMRB bmse010140 1 C25 C25 BMRB bmse010140 1 C26 C26 BMRB bmse010140 1 C27 C27 BMRB bmse010140 1 O28 O28 BMRB bmse010140 1 O29 O29 BMRB bmse010140 1 O30 O30 BMRB bmse010140 1 O31 O31 BMRB bmse010140 1 O32 O32 BMRB bmse010140 1 O33 O33 BMRB bmse010140 1 O34 O34 BMRB bmse010140 1 O35 O35 BMRB bmse010140 1 O36 O36 BMRB bmse010140 1 O37 O37 BMRB bmse010140 1 O38 O38 BMRB bmse010140 1 O39 O39 BMRB bmse010140 1 H40 H40 BMRB bmse010140 1 H41 H41 BMRB bmse010140 1 H42 H42 BMRB bmse010140 1 H43 H43 BMRB bmse010140 1 H44 H44 BMRB bmse010140 1 H45 H45 BMRB bmse010140 1 H46 H46 BMRB bmse010140 1 H47 H47 BMRB bmse010140 1 H48 H48 BMRB bmse010140 1 H49 H49 BMRB bmse010140 1 H50 H50 BMRB bmse010140 1 H51 H51 BMRB bmse010140 1 H52 H52 BMRB bmse010140 1 H53 H53 BMRB bmse010140 1 H54 H54 BMRB bmse010140 1 H55 H55 BMRB bmse010140 1 H56 H56 BMRB bmse010140 1 H57 H57 BMRB bmse010140 1 H58 H58 BMRB bmse010140 1 H59 H59 BMRB bmse010140 1 H60 H60 BMRB bmse010140 1 H61 H61 BMRB bmse010140 1 H62 H62 BMRB bmse010140 1 H63 H63 BMRB bmse010140 1 H64 H64 BMRB bmse010140 1 H65 H65 BMRB bmse010140 1 H66 H66 BMRB bmse010140 1 H67 H67 BMRB bmse010140 1 H68 H68 BMRB bmse010140 1 H69 H69 BMRB bmse010140 1 H70 H70 BMRB bmse010140 1 H71 H71 BMRB bmse010140 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C15 ? bmse010140 1 2 covalent SING C2 C16 ? bmse010140 1 3 covalent SING C3 C17 ? bmse010140 1 4 covalent SING C4 C18 ? bmse010140 1 5 covalent SING C5 O32 ? bmse010140 1 6 covalent SING C6 O33 ? bmse010140 1 7 covalent SING C7 O34 ? bmse010140 1 8 covalent DOUB C8 C9 ? bmse010140 1 9 covalent SING C8 C19 ? bmse010140 1 10 covalent SING C9 C21 ? bmse010140 1 11 covalent DOUB C10 C19 ? bmse010140 1 12 covalent SING C10 C22 ? bmse010140 1 13 covalent DOUB C11 C20 ? bmse010140 1 14 covalent SING C11 C23 ? bmse010140 1 15 covalent SING C12 C20 ? bmse010140 1 16 covalent DOUB C12 C24 ? bmse010140 1 17 covalent SING C13 C19 ? bmse010140 1 18 covalent SING C13 O35 ? bmse010140 1 19 covalent SING C14 C25 ? bmse010140 1 20 covalent SING C14 O36 ? bmse010140 1 21 covalent DOUB C15 O28 ? bmse010140 1 22 covalent SING C15 O35 ? bmse010140 1 23 covalent DOUB C16 O29 ? bmse010140 1 24 covalent SING C16 O36 ? bmse010140 1 25 covalent DOUB C17 O30 ? bmse010140 1 26 covalent SING C17 O37 ? bmse010140 1 27 covalent DOUB C18 O31 ? bmse010140 1 28 covalent SING C18 O38 ? bmse010140 1 29 covalent SING C20 C26 ? bmse010140 1 30 covalent DOUB C21 C22 ? bmse010140 1 31 covalent SING C21 O39 ? bmse010140 1 32 covalent SING C22 O32 ? bmse010140 1 33 covalent DOUB C23 C27 ? bmse010140 1 34 covalent SING C23 O33 ? bmse010140 1 35 covalent SING C24 C27 ? bmse010140 1 36 covalent SING C24 O34 ? bmse010140 1 37 covalent SING C25 C26 ? bmse010140 1 38 covalent SING C25 O39 ? bmse010140 1 39 covalent SING C26 O37 ? bmse010140 1 40 covalent SING C27 O38 ? bmse010140 1 41 covalent SING C1 H40 ? bmse010140 1 42 covalent SING C1 H41 ? bmse010140 1 43 covalent SING C1 H42 ? bmse010140 1 44 covalent SING C2 H43 ? bmse010140 1 45 covalent SING C2 H44 ? bmse010140 1 46 covalent SING C2 H45 ? bmse010140 1 47 covalent SING C3 H46 ? bmse010140 1 48 covalent SING C3 H47 ? bmse010140 1 49 covalent SING C3 H48 ? bmse010140 1 50 covalent SING C4 H49 ? bmse010140 1 51 covalent SING C4 H50 ? bmse010140 1 52 covalent SING C4 H51 ? bmse010140 1 53 covalent SING C5 H52 ? bmse010140 1 54 covalent SING C5 H53 ? bmse010140 1 55 covalent SING C5 H54 ? bmse010140 1 56 covalent SING C6 H55 ? bmse010140 1 57 covalent SING C6 H56 ? bmse010140 1 58 covalent SING C6 H57 ? bmse010140 1 59 covalent SING C7 H58 ? bmse010140 1 60 covalent SING C7 H59 ? bmse010140 1 61 covalent SING C7 H60 ? bmse010140 1 62 covalent SING C8 H61 ? bmse010140 1 63 covalent SING C9 H62 ? bmse010140 1 64 covalent SING C10 H63 ? bmse010140 1 65 covalent SING C11 H64 ? bmse010140 1 66 covalent SING C12 H65 ? bmse010140 1 67 covalent SING C13 H66 ? bmse010140 1 68 covalent SING C13 H67 ? bmse010140 1 69 covalent SING C14 H68 ? bmse010140 1 70 covalent SING C14 H69 ? bmse010140 1 71 covalent SING C25 H70 ? bmse010140 1 72 covalent SING C26 H71 ? bmse010140 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 213 "Compound Number" ? lignin_cw_compound_213 ? "matching entry" ? bmse010140 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010140 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010140 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_213 "natural abundance" 1 $lignin_cw_compound_213 ? Solute Saturated ? ? 1 ? "Tracey Duch" "Syringylgycerol-B-vanillyl alcohol ether tetra-acetate" n/a bmse010140 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010140 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010140 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_213 "natural abundance" 1 $lignin_cw_compound_213 ? Solute Saturated ? ? 1 ? "Tracey Duch" "Syringylgycerol-B-vanillyl alcohol ether tetra-acetate" n/a bmse010140 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010140 2 stop_ save_ save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010140 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_213 "natural abundance" 1 $lignin_cw_compound_213 ? Solute Saturated ? ? 1 ? "Tracey Duch" "Syringylgycerol-B-vanillyl alcohol ether tetra-acetate" n/a bmse010140 3 2 DMSO "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010140 3 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010140 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010140 1 temperature 297 ? K bmse010140 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010140 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010140 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010140 1 stop_ save_ save_Bruker_250 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_250 _NMR_spectrometer.Entry_ID bmse010140 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model WM _NMR_spectrometer.Field_strength 250 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010140 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010140 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010140 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010140 1 4 "1D 13C" no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010140 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010140 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010140 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010140 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010140 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010140 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010140 2 stop_ save_ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010140 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 "residual solvent methyl proton" ppm 2.49 internal direct 1.000000000 ? ? ? bmse010140 3 C 13 DMSO-d6 "solvent methyl carbon" ppm 39.50 internal direct ? ? ? ? bmse010140 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010140 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010140 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010140 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 20.36 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 1 2 ? 1 1 1 1 1 C2 C 13 20.64 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 1 3 ? 1 1 1 1 1 C3 C 13 20.97 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 1 4 ? 1 1 1 1 1 C4 C 13 20.97 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 1 5 ? 1 1 1 1 1 C5 C 13 55.80 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 1 6 ? 1 1 1 1 1 C6 C 13 56.14 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 1 7 ? 1 1 1 1 1 C7 C 13 56.14 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 1 8 ? 1 1 1 1 1 C14 C 13 62.91 ? ? 1 ? ? ? ? ? G ? bmse010140 1 9 ? 1 1 1 1 1 C13 C 13 66.08 ? ? 1 ? ? ? ? ? BA ? bmse010140 1 10 ? 1 1 1 1 1 C26 C 13 74.57 ? ? 1 ? ? ? ? ? A ? bmse010140 1 11 ? 1 1 1 1 1 C25 C 13 80.14 ? ? 1 ? ? ? ? ? B ? bmse010140 1 12 ? 1 1 1 1 1 C11 C 13 104.02 ? ? 1 ? ? ? ? ? A2 ? bmse010140 1 13 ? 1 1 1 1 1 C12 C 13 104.02 ? ? 1 ? ? ? ? ? A6 ? bmse010140 1 14 ? 1 1 1 1 1 C10 C 13 112.70 ? ? 1 ? ? ? ? ? B2 ? bmse010140 1 15 ? 1 1 1 1 1 C9 C 13 118.12 ? ? 1 ? ? ? ? ? B5 ? bmse010140 1 16 ? 1 1 1 1 1 C8 C 13 121.15 ? ? 1 ? ? ? ? ? B6 ? bmse010140 1 17 ? 1 1 1 1 1 C27 C 13 128.79 ? ? 1 ? ? ? ? ? A4 ? bmse010140 1 18 ? 1 1 1 1 1 C19 C 13 130.88 ? ? 1 ? ? ? ? ? B1 ? bmse010140 1 19 ? 1 1 1 1 1 C20 C 13 134.63 ? ? 1 ? ? ? ? ? A1 ? bmse010140 1 20 ? 1 1 1 1 1 C21 C 13 147.90 ? ? 1 ? ? ? ? ? B4 ? bmse010140 1 21 ? 1 1 1 1 1 C22 C 13 150.60 ? ? 1 ? ? ? ? ? B3 ? bmse010140 1 22 ? 1 1 1 1 1 C23 C 13 152.14 ? ? 1 ? ? ? ? ? A3 ? bmse010140 1 23 ? 1 1 1 1 1 C24 C 13 152.14 ? ? 1 ? ? ? ? ? A5 ? bmse010140 1 24 ? 1 1 1 1 1 C18 C 13 168.42 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010140 1 25 ? 1 1 1 1 1 C17 C 13 169.60 ? ? 1 ? ? ? ? ? AAcC=O ? bmse010140 1 26 ? 1 1 1 1 1 C16 C 13 170.48 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010140 1 27 ? 1 1 1 1 1 C15 C 13 170.79 ? ? 1 ? ? ? ? ? BAAcC=O ? bmse010140 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010140 1 1 2 bmse010140 1 1 3 bmse010140 1 1 4 bmse010140 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010140 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010140 2 3 "1D 13C" 2 $sample_2 bmse010140 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010140 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 20.24 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 2 ? 1 1 1 1 1 C2 C 13 20.63 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 3 ? 1 1 1 1 1 C3 C 13 20.83 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 4 ? 1 1 1 1 1 C4 C 13 20.95 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 5 ? 1 1 1 1 1 C5 C 13 56.31 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 2 6 ? 1 1 1 1 1 C6 C 13 56.55 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 7 ? 1 1 1 1 1 C7 C 13 56.55 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 8 ? 1 1 1 1 1 C14 C 13 63.59 ? ? 1 ? ? ? ? ? G ? bmse010140 2 9 ? 1 1 1 1 1 C13 C 13 66.35 ? ? 1 ? ? ? ? ? BA ? bmse010140 2 10 ? 1 1 1 1 1 C26 C 13 75.64 ? ? 1 ? ? ? ? ? A ? bmse010140 2 11 ? 1 1 1 1 1 C25 C 13 80.72 ? ? 1 ? ? ? ? ? B ? bmse010140 2 12 ? 1 1 1 1 1 C11 C 13 105.13 ? ? 1 ? ? ? ? ? A2 ? bmse010140 2 13 ? 1 1 1 1 1 C12 C 13 105.13 ? ? 1 ? ? ? ? ? A6 ? bmse010140 2 14 ? 1 1 1 1 1 C10 C 13 113.94 ? ? 1 ? ? ? ? ? B2 ? bmse010140 2 15 ? 1 1 1 1 1 C9 C 13 118.67 ? ? 1 ? ? ? ? ? B5 ? bmse010140 2 16 ? 1 1 1 1 1 C8 C 13 121.77 ? ? 1 ? ? ? ? ? B6 ? bmse010140 2 17 ? 1 1 1 1 1 C27 C 13 129.70 ? ? 1 ? ? ? ? ? A4 ? bmse010140 2 18 ? 1 1 1 1 1 C19 C 13 132.09 ? ? 1 ? ? ? ? ? B1 ? bmse010140 2 19 ? 1 1 1 1 1 C20 C 13 136.18 ? ? 1 ? ? ? ? ? A1 ? bmse010140 2 20 ? 1 1 1 1 1 C21 C 13 148.97 ? ? 1 ? ? ? ? ? B4 ? bmse010140 2 21 ? 1 1 1 1 1 C22 C 13 151.57 ? ? 1 ? ? ? ? ? B3 ? bmse010140 2 22 ? 1 1 1 1 1 C23 C 13 153.21 ? ? 1 ? ? ? ? ? A3 ? bmse010140 2 23 ? 1 1 1 1 1 C24 C 13 153.21 ? ? 1 ? ? ? ? ? A5 ? bmse010140 2 24 ? 1 1 1 1 1 C18 C 13 168.46 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010140 2 25 ? 1 1 1 1 1 C17 C 13 170.02 ? ? 1 ? ? ? ? ? AAcC=O ? bmse010140 2 26 ? 1 1 1 1 1 C16 C 13 170.72 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010140 2 27 ? 1 1 1 1 1 C15 C 13 170.88 ? ? 1 ? ? ? ? ? BAAcC=O ? bmse010140 2 28 ? 1 1 1 1 1 H40 H 1 1.98 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 29 ? 1 1 1 1 1 H41 H 1 1.98 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 30 ? 1 1 1 1 1 H42 H 1 1.98 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 31 ? 1 1 1 1 1 H43 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 32 ? 1 1 1 1 1 H44 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 33 ? 1 1 1 1 1 H45 H 1 2.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 34 ? 1 1 1 1 1 H46 H 1 2.09 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 35 ? 1 1 1 1 1 H47 H 1 2.09 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 36 ? 1 1 1 1 1 H48 H 1 2.09 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 2 37 ? 1 1 1 1 1 H49 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010140 2 38 ? 1 1 1 1 1 H50 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010140 2 39 ? 1 1 1 1 1 H51 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010140 2 40 ? 1 1 1 1 1 H55 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 41 ? 1 1 1 1 1 H56 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 42 ? 1 1 1 1 1 H57 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 43 ? 1 1 1 1 1 H58 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 44 ? 1 1 1 1 1 H59 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 45 ? 1 1 1 1 1 H60 H 1 3.80 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 2 46 ? 1 1 1 1 1 H52 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 2 47 ? 1 1 1 1 1 H53 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 2 48 ? 1 1 1 1 1 H54 H 1 3.83 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 2 49 ? 1 1 1 1 1 H68 H 1 4.05 ? ? 1 ? ? ? ? ? G1 ? bmse010140 2 50 ? 1 1 1 1 1 H69 H 1 4.27 ? ? 1 ? ? ? ? ? G2 ? bmse010140 2 51 ? 1 1 1 1 1 H70 H 1 4.81 ? ? 1 ? ? ? ? ? B ? bmse010140 2 52 ? 1 1 1 1 1 H66 H 1 5.02 ? ? 1 ? ? ? ? ? BA ? bmse010140 2 53 ? 1 1 1 1 1 H67 H 1 5.02 ? ? 1 ? ? ? ? ? BA ? bmse010140 2 54 ? 1 1 1 1 1 H71 H 1 6.08 ? ? 1 ? ? ? ? ? A ? bmse010140 2 55 ? 1 1 1 1 1 H64 H 1 6.86 ? ? 1 ? ? ? ? ? A2 ? bmse010140 2 56 ? 1 1 1 1 1 H65 H 1 6.86 ? ? 1 ? ? ? ? ? A6 ? bmse010140 2 57 ? 1 1 1 1 1 H61 H 1 6.91 ? ? 1 ? ? ? ? ? B6 ? bmse010140 2 58 ? 1 1 1 1 1 H62 H 1 7.03 ? ? 1 ? ? ? ? ? B5 ? bmse010140 2 59 ? 1 1 1 1 1 H63 H 1 7.05 ? ? 1 ? ? ? ? ? B2 ? bmse010140 2 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010140 2 1 2 bmse010140 2 1 3 bmse010140 2 1 4 bmse010140 2 2 28 bmse010140 2 2 29 bmse010140 2 2 30 bmse010140 2 2 31 bmse010140 2 2 32 bmse010140 2 2 33 bmse010140 2 2 34 bmse010140 2 2 35 bmse010140 2 2 36 bmse010140 2 stop_ save_ save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010140 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 4 "1D 13C" 3 $sample_3 bmse010140 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010140 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 20.03 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 3 2 ? 1 1 1 1 1 C2 C 13 20.38 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 3 3 ? 1 1 1 1 1 C3 C 13 20.65 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 3 4 ? 1 1 1 1 1 C4 C 13 20.65 ? ? 4 ? ? ? ? ? AcMe ? bmse010140 3 5 ? 1 1 1 1 1 C5 C 13 55.60 ? ? 1 ? ? ? ? ? BOMe ? bmse010140 3 6 ? 1 1 1 1 1 C6 C 13 55.98 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 3 7 ? 1 1 1 1 1 C7 C 13 55.98 ? ? 1 ? ? ? ? ? AOMe ? bmse010140 3 8 ? 1 1 1 1 1 C14 C 13 63.37 ? ? 1 ? ? ? ? ? G ? bmse010140 3 9 ? 1 1 1 1 1 C13 C 13 65.28 ? ? 1 ? ? ? ? ? BA ? bmse010140 3 10 ? 1 1 1 1 1 C26 C 13 74.48 ? ? 1 ? ? ? ? ? A ? bmse010140 3 11 ? 1 1 1 1 1 C25 C 13 79.02 ? ? 1 ? ? ? ? ? B ? bmse010140 3 12 ? 1 1 1 1 1 C11 C 13 103.94 ? ? 1 ? ? ? ? ? A2 ? bmse010140 3 13 ? 1 1 1 1 1 C12 C 13 103.94 ? ? 1 ? ? ? ? ? A6 ? bmse010140 3 14 ? 1 1 1 1 1 C10 C 13 112.86 ? ? 1 ? ? ? ? ? B2 ? bmse010140 3 15 ? 1 1 1 1 1 C9 C 13 116.91 ? ? 1 ? ? ? ? ? B5 ? bmse010140 3 16 ? 1 1 1 1 1 C8 C 13 120.69 ? ? 1 ? ? ? ? ? B6 ? bmse010140 3 17 ? 1 1 1 1 1 C27 C 13 127.92 ? ? 1 ? ? ? ? ? A4 ? bmse010140 3 18 ? 1 1 1 1 1 C19 C 13 130.30 ? ? 1 ? ? ? ? ? B1 ? bmse010140 3 19 ? 1 1 1 1 1 C20 C 13 134.92 ? ? 1 ? ? ? ? ? A1 ? bmse010140 3 20 ? 1 1 1 1 1 C21 C 13 147.38 ? ? 1 ? ? ? ? ? B4 ? bmse010140 3 21 ? 1 1 1 1 1 C22 C 13 149.79 ? ? 1 ? ? ? ? ? B3 ? bmse010140 3 22 ? 1 1 1 1 1 C23 C 13 151.55 ? ? 1 ? ? ? ? ? A3 ? bmse010140 3 23 ? 1 1 1 1 1 C24 C 13 151.55 ? ? 1 ? ? ? ? ? A5 ? bmse010140 3 24 ? 1 1 1 1 1 C18 C 13 167.88 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010140 3 25 ? 1 1 1 1 1 C17 C 13 169.32 ? ? 1 ? ? ? ? ? AAcC=O ? bmse010140 3 26 ? 1 1 1 1 1 C16 C 13 167.94 ? ? 1 ? ? ? ? ? GAcC=O ? bmse010140 3 27 ? 1 1 1 1 1 C15 C 13 170.15 ? ? 1 ? ? ? ? ? BAAcC=O ? bmse010140 3 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 1 bmse010140 3 1 2 bmse010140 3 1 3 bmse010140 3 1 4 bmse010140 3 stop_ save_