data_bmse010143 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010143 _Entry.Title G_b_G_c_CA_acetate _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2009-09-01 _Entry.Last_release_date 2012-09-13 _Entry.Original_release_date 2010-02-08 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name G_b_G_c_CA_acetate loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.First_initial _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 John Ralph ? ? ? bmse010143 2 Sally Ralph ? ? ? bmse010143 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010143 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010143 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 120 bmse010143 "1H chemical shifts" 40 bmse010143 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2010-02-08 2009-05-26 original Author "Original spectra from USDA" bmse010143 2 2010-12-01 2010-12-01 update BMRB "Set correct NMR STAR version" bmse010143 3 2011-04-04 2011-04-04 update BMRB "Added Provenance tag to chem_comp" bmse010143 4 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010143 5 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010143 6 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010143 7 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010143 8 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010143 9 2012-09-13 2012-09-13 update BMRB "Added PubChem SID 111678013 to database loop" bmse010143 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010143 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010143 1 2 John Ralph ? ? ? bmse010143 1 3 Larry Landucci ? L. ? bmse010143 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010143 _Assembly.ID 1 _Assembly.Name 'G-b-G-c-CA (acetate)' _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 G-b-G-c-CA-(acetate) 1 $G-b-G-c-CA-(acetate) yes native no no ? ? ? bmse010143 1 stop_ save_ save_G-b-G-c-CA-(acetate) _Entity.Sf_category entity _Entity.Sf_framecode G-b-G-c-CA-(acetate) _Entity.Entry_ID bmse010143 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'G-b-G-c-CA (acetate)' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010143 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010143 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $G-b-G-c-CA-(acetate) . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010143 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010143 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $G-b-G-c-CA-(acetate) . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010143 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010143 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name 'G-b-G-c-CA (acetate)' _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C40H44O15/c1-22(41)49-15-9-10-27-16-30-31(20-50-23(2)42)38(55-40(30)36(17-27)48-8)28-11-14-33(35(18-28)47-7)54-37(21-51-24(3)43)39(53-26(5)45)29-12-13-32(52-25(4)44)34(19-29)46-6/h9-14,16-19,31,37-39H,15,20-21H2,1-8H3/b10-9+ ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C40 H44 O15' _Chem_comp.Formula_weight 764.76836 _Chem_comp.Formula_mono_iso_wt_nat 764.2680207439 _Chem_comp.Formula_mono_iso_wt_13C 804.4022142559 _Chem_comp.Formula_mono_iso_wt_15N 764.2680207439 _Chem_comp.Formula_mono_iso_wt_13C_15N 804.4022142559 _Chem_comp.Image_file_name standards/G_b_G_c_CA_acetate/lit/jr_216.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/G_b_G_c_CA_acetate/lit/jr_216.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "G-b-G-c-CA (acetate)" synonym bmse010143 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "G-b-G-c-CA (acetate)" "Lignin abbreviation" bmse010143 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical ; CC(=O)OCC=CC1=CC4=C(C(=C1)OC)OC(C2=CC(=C(C=C2)OC(COC(C)=O)C(C3=CC(=C(C=C3)OC(C)=O)OC)OC(C)=O)OC)C4COC(C)=O ; bmse010143 1 Isomeric ; CC(=O)OCC=CC1=CC4=C(C(=C1)OC)OC(C2=CC(=C(C=C2)OC(COC(C)=O)C(C3=CC(=C(C=C3)OC(C)=O)OC)OC(C)=O)OC)C4COC(C)=O ; bmse010143 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 CGAcMe C ? ? ? ? 13.1300 166.0300 ? ? ? bmse010143 1 C2 BGAcMe C ? ? ? ? 227.9330 276.8590 ? ? ? bmse010143 1 C3 AGAcMe C ? ? ? ? 356.8700 254.9530 ? ? ? bmse010143 1 C4 A4AcMe C ? ? ? ? 536.8700 306.9130 ? ? ? bmse010143 1 C5 AAAcMe C ? ? ? ? 491.8700 125.0470 ? ? ? bmse010143 1 C6 OMe C ? ? ? ? 446.8700 306.9130 ? ? ? bmse010143 1 C7 OMe C ? ? ? ? 341.8700 73.0870 ? ? ? bmse010143 1 C8 OMe C ? ? ? ? 169.0160 76.0300 ? ? ? bmse010143 1 C9 CB C ? ? ? ? 117.0530 166.0300 ? ? ? bmse010143 1 C10 CA C ? ? ? ? 143.0330 181.0300 ? ? ? bmse010143 1 C11 B6 C ? ? ? ? 311.8700 177.0100 ? ? ? bmse010143 1 C12 A6 C ? ? ? ? 476.8700 202.9900 ? ? ? bmse010143 1 C13 A5 C ? ? ? ? 491.8700 228.9700 ? ? ? bmse010143 1 C14 B5 C ? ? ? ? 341.8700 177.0100 ? ? ? bmse010143 1 C15 CG C ? ? ? ? 91.0730 181.0300 ? ? ? bmse010143 1 C16 C6 C ? ? ? ? 194.9960 181.0300 ? ? ? bmse010143 1 C17 C2 C ? ? ? ? 169.0160 136.0300 ? ? ? bmse010143 1 C18 B2 C ? ? ? ? 311.8700 125.0470 ? ? ? bmse010143 1 C19 A2 C ? ? ? ? 431.8700 228.9700 ? ? ? bmse010143 1 C20 BG C ? ? ? ? 258.6830 203.6860 ? ? ? bmse010143 1 C21 G C ? ? ? ? 386.8700 202.9900 ? ? ? bmse010143 1 C22 CGC=O C ? ? ? ? 39.1100 181.0300 ? ? ? bmse010143 1 C23 BGC=O C ? ? ? ? 247.9670 254.5300 ? ? ? bmse010143 1 C24 AGC=O C ? ? ? ? 386.8700 254.9530 ? ? ? bmse010143 1 C25 A4C=O C ? ? ? ? 521.8700 280.9330 ? ? ? bmse010143 1 C26 AAC=O C ? ? ? ? 476.8700 151.0300 ? ? ? bmse010143 1 C27 C1 C ? ? ? ? 169.0160 166.0300 ? ? ? bmse010143 1 C28 B1 C ? ? ? ? 296.8700 151.0300 ? ? ? bmse010143 1 C29 A1 C ? ? ? ? 446.8700 202.9900 ? ? ? bmse010143 1 C30 C5 C ? ? ? ? 220.9760 166.0300 ? ? ? bmse010143 1 C31 BB C ? ? ? ? 249.3620 175.1710 ? ? ? bmse010143 1 C32 A4 C ? ? ? ? 476.8700 254.9530 ? ? ? bmse010143 1 C33 B4 C ? ? ? ? 356.8700 151.0300 ? ? ? bmse010143 1 C34 A3 C ? ? ? ? 446.8700 254.9530 ? ? ? bmse010143 1 C35 B3 C ? ? ? ? 341.8700 125.0470 ? ? ? bmse010143 1 C36 C3 C ? ? ? ? 194.9960 121.0300 ? ? ? bmse010143 1 C37 B C ? ? ? ? 401.8700 177.0100 ? ? ? bmse010143 1 C38 BA C ? ? ? ? 266.8700 151.0300 ? ? ? bmse010143 1 C39 A C ? ? ? ? 431.8700 177.0100 ? ? ? bmse010143 1 C40 C4 C ? ? ? ? 220.9760 136.0300 ? ? ? bmse010143 1 O41 ? O ? ? ? ? 39.1100 211.0300 ? ? ? bmse010143 1 O42 ? O ? ? ? ? 277.3220 260.7190 ? ? ? bmse010143 1 O43 ? O ? ? ? ? 401.8700 280.9330 ? ? ? bmse010143 1 O44 ? O ? ? ? ? 536.8700 254.9530 ? ? ? bmse010143 1 O45 ? O ? ? ? ? 491.8700 177.0100 ? ? ? bmse010143 1 O46 ? O ? ? ? ? 431.8700 280.9330 ? ? ? bmse010143 1 O47 ? O ? ? ? ? 356.8700 99.0670 ? ? ? bmse010143 1 O48 ? O ? ? ? ? 194.9960 91.0300 ? ? ? bmse010143 1 O49 ? O ? ? ? ? 65.0930 166.0300 ? ? ? bmse010143 1 O50 ? O ? ? ? ? 238.6460 226.0150 ? ? ? bmse010143 1 O51 ? O ? ? ? ? 401.8700 228.9700 ? ? ? bmse010143 1 O52 ? O ? ? ? ? 491.8700 280.9330 ? ? ? bmse010143 1 O53 ? O ? ? ? ? 446.8700 151.0300 ? ? ? bmse010143 1 O54 ? O ? ? ? ? 386.8700 151.0300 ? ? ? bmse010143 1 O55 ? O ? ? ? ? 249.3620 126.8860 ? ? ? bmse010143 1 H56 CGAcMe H ? ? ? ? 3.8298 182.1380 ? ? ? bmse010143 1 H57 CGAcMe H ? ? ? ? -2.9780 156.7298 ? ? ? bmse010143 1 H58 CGAcMe H ? ? ? ? 22.4302 149.9220 ? ? ? bmse010143 1 H59 BGAcMe H ? ? ? ? 241.7774 289.2805 ? ? ? bmse010143 1 H60 BGAcMe H ? ? ? ? 215.5116 290.7034 ? ? ? bmse010143 1 H61 BGAcMe H ? ? ? ? 214.0886 264.4376 ? ? ? bmse010143 1 H62 AGAcMe H ? ? ? ? 356.8700 273.5530 ? ? ? bmse010143 1 H63 AGAcMe H ? ? ? ? 338.2700 254.9530 ? ? ? bmse010143 1 H64 AGAcMe H ? ? ? ? 356.8700 236.3530 ? ? ? bmse010143 1 H65 A4AcMe H ? ? ? ? 552.9780 297.6128 ? ? ? bmse010143 1 H66 A4AcMe H ? ? ? ? 546.1702 323.0209 ? ? ? bmse010143 1 H67 A4AcMe H ? ? ? ? 520.7620 316.2132 ? ? ? bmse010143 1 H68 AAAcMe H ? ? ? ? 475.7616 115.7476 ? ? ? bmse010143 1 H69 AAAcMe H ? ? ? ? 501.1694 108.9386 ? ? ? bmse010143 1 H70 AAAcMe H ? ? ? ? 507.9784 134.3464 ? ? ? bmse010143 1 H71 AOMe H ? ? ? ? 462.9779 297.6128 ? ? ? bmse010143 1 H72 AOMe H ? ? ? ? 456.1702 323.0209 ? ? ? bmse010143 1 H73 AOMe H ? ? ? ? 430.7621 316.2132 ? ? ? bmse010143 1 H74 BOMe H ? ? ? ? 325.7621 82.3872 ? ? ? bmse010143 1 H75 BOMe H ? ? ? ? 332.5698 56.9790 ? ? ? bmse010143 1 H76 BOMe H ? ? ? ? 357.9779 63.7868 ? ? ? bmse010143 1 H77 COMe H ? ? ? ? 159.7158 92.1380 ? ? ? bmse010143 1 H78 COMe H ? ? ? ? 152.9081 66.7298 ? ? ? bmse010143 1 H79 COMe H ? ? ? ? 178.3162 59.9220 ? ? ? bmse010143 1 H80 CB H ? ? ? ? 117.0530 147.4300 ? ? ? bmse010143 1 H81 CA H ? ? ? ? 143.0325 199.6300 ? ? ? bmse010143 1 H82 B6 H ? ? ? ? 302.5701 193.1181 ? ? ? bmse010143 1 H83 ? H ? ? ? ? 486.1699 186.8819 ? ? ? bmse010143 1 H84 ? H ? ? ? ? 510.4700 228.9695 ? ? ? bmse010143 1 H85 B5 H ? ? ? ? 351.1699 193.1181 ? ? ? bmse010143 1 H86 CG H ? ? ? ? 103.0289 195.2784 ? ? ? bmse010143 1 H87 CG H ? ? ? ? 79.1171 195.2784 ? ? ? bmse010143 1 H88 ? H ? ? ? ? 194.9960 199.6300 ? ? ? bmse010143 1 H89 ? H ? ? ? ? 152.9079 126.7301 ? ? ? bmse010143 1 H90 B2 H ? ? ? ? 302.5697 108.9391 ? ? ? bmse010143 1 H91 A2 H ? ? ? ? 413.2700 228.9695 ? ? ? bmse010143 1 H92 BG1 H ? ? ? ? 275.0906 194.9252 ? ? ? bmse010143 1 H93 BG2 H ? ? ? ? 270.1595 218.3233 ? ? ? bmse010143 1 H94 AG1 H ? ? ? ? 372.6216 214.9459 ? ? ? bmse010143 1 H95 AG2 H ? ? ? ? 372.6216 191.0341 ? ? ? bmse010143 1 H96 ? H ? ? ? ? 236.2387 188.3521 ? ? ? bmse010143 1 H97 B H ? ? ? ? 411.1699 160.9019 ? ? ? bmse010143 1 H98 BA H ? ? ? ? 275.3213 167.5991 ? ? ? bmse010143 1 H99 A H ? ? ? ? 422.5701 160.9019 ? ? ? bmse010143 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010143 1 C2 C2 BMRB bmse010143 1 C3 C3 BMRB bmse010143 1 C4 C4 BMRB bmse010143 1 C5 C5 BMRB bmse010143 1 C6 C6 BMRB bmse010143 1 C7 C7 BMRB bmse010143 1 C8 C8 BMRB bmse010143 1 C9 C9 BMRB bmse010143 1 C10 C10 BMRB bmse010143 1 C11 C11 BMRB bmse010143 1 C12 C12 BMRB bmse010143 1 C13 C13 BMRB bmse010143 1 C14 C14 BMRB bmse010143 1 C15 C15 BMRB bmse010143 1 C16 C16 BMRB bmse010143 1 C17 C17 BMRB bmse010143 1 C18 C18 BMRB bmse010143 1 C19 C19 BMRB bmse010143 1 C20 C20 BMRB bmse010143 1 C21 C21 BMRB bmse010143 1 C22 C22 BMRB bmse010143 1 C23 C23 BMRB bmse010143 1 C24 C24 BMRB bmse010143 1 C25 C25 BMRB bmse010143 1 C26 C26 BMRB bmse010143 1 C27 C27 BMRB bmse010143 1 C28 C28 BMRB bmse010143 1 C29 C29 BMRB bmse010143 1 C30 C30 BMRB bmse010143 1 C31 C31 BMRB bmse010143 1 C32 C32 BMRB bmse010143 1 C33 C33 BMRB bmse010143 1 C34 C34 BMRB bmse010143 1 C35 C35 BMRB bmse010143 1 C36 C36 BMRB bmse010143 1 C37 C37 BMRB bmse010143 1 C38 C38 BMRB bmse010143 1 C39 C39 BMRB bmse010143 1 C40 C40 BMRB bmse010143 1 O41 O41 BMRB bmse010143 1 O42 O42 BMRB bmse010143 1 O43 O43 BMRB bmse010143 1 O44 O44 BMRB bmse010143 1 O45 O45 BMRB bmse010143 1 O46 O46 BMRB bmse010143 1 O47 O47 BMRB bmse010143 1 O48 O48 BMRB bmse010143 1 O49 O49 BMRB bmse010143 1 O50 O50 BMRB bmse010143 1 O51 O51 BMRB bmse010143 1 O52 O52 BMRB bmse010143 1 O53 O53 BMRB bmse010143 1 O54 O54 BMRB bmse010143 1 O55 O55 BMRB bmse010143 1 H56 H56 BMRB bmse010143 1 H57 H57 BMRB bmse010143 1 H58 H58 BMRB bmse010143 1 H59 H59 BMRB bmse010143 1 H60 H60 BMRB bmse010143 1 H61 H61 BMRB bmse010143 1 H62 H62 BMRB bmse010143 1 H63 H63 BMRB bmse010143 1 H64 H64 BMRB bmse010143 1 H65 H65 BMRB bmse010143 1 H66 H66 BMRB bmse010143 1 H67 H67 BMRB bmse010143 1 H68 H68 BMRB bmse010143 1 H69 H69 BMRB bmse010143 1 H70 H70 BMRB bmse010143 1 H71 H71 BMRB bmse010143 1 H72 H72 BMRB bmse010143 1 H73 H73 BMRB bmse010143 1 H74 H74 BMRB bmse010143 1 H75 H75 BMRB bmse010143 1 H76 H76 BMRB bmse010143 1 H77 H77 BMRB bmse010143 1 H78 H78 BMRB bmse010143 1 H79 H79 BMRB bmse010143 1 H80 H80 BMRB bmse010143 1 H81 H81 BMRB bmse010143 1 H82 H82 BMRB bmse010143 1 H83 H83 BMRB bmse010143 1 H84 H84 BMRB bmse010143 1 H85 H85 BMRB bmse010143 1 H86 H86 BMRB bmse010143 1 H87 H87 BMRB bmse010143 1 H88 H88 BMRB bmse010143 1 H89 H89 BMRB bmse010143 1 H90 H90 BMRB bmse010143 1 H91 H91 BMRB bmse010143 1 H92 H92 BMRB bmse010143 1 H93 H93 BMRB bmse010143 1 H94 H94 BMRB bmse010143 1 H95 H95 BMRB bmse010143 1 H96 H96 BMRB bmse010143 1 H97 H97 BMRB bmse010143 1 H98 H98 BMRB bmse010143 1 H99 H99 BMRB bmse010143 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C22 ? bmse010143 1 2 covalent SING C2 C23 ? bmse010143 1 3 covalent SING C3 C24 ? bmse010143 1 4 covalent SING C4 C25 ? bmse010143 1 5 covalent SING C5 C26 ? bmse010143 1 6 covalent SING C6 O46 ? bmse010143 1 7 covalent SING C7 O47 ? bmse010143 1 8 covalent SING C8 O48 ? bmse010143 1 9 covalent DOUB C9 C10 ? bmse010143 1 10 covalent SING C9 C15 ? bmse010143 1 11 covalent SING C10 C27 ? bmse010143 1 12 covalent DOUB C11 C14 ? bmse010143 1 13 covalent SING C11 C28 ? bmse010143 1 14 covalent DOUB C12 C13 ? bmse010143 1 15 covalent SING C12 C29 ? bmse010143 1 16 covalent SING C13 C32 ? bmse010143 1 17 covalent SING C14 C33 ? bmse010143 1 18 covalent SING C15 O49 ? bmse010143 1 19 covalent DOUB C16 C27 ? bmse010143 1 20 covalent SING C16 C30 ? bmse010143 1 21 covalent SING C17 C27 ? bmse010143 1 22 covalent DOUB C17 C36 ? bmse010143 1 23 covalent DOUB C18 C28 ? bmse010143 1 24 covalent SING C18 C35 ? bmse010143 1 25 covalent DOUB C19 C29 ? bmse010143 1 26 covalent SING C19 C34 ? bmse010143 1 27 covalent SING C20 C31 ? bmse010143 1 28 covalent SING C20 O50 ? bmse010143 1 29 covalent SING C21 C37 ? bmse010143 1 30 covalent SING C21 O51 ? bmse010143 1 31 covalent DOUB C22 O41 ? bmse010143 1 32 covalent SING C22 O49 ? bmse010143 1 33 covalent DOUB C23 O42 ? bmse010143 1 34 covalent SING C23 O50 ? bmse010143 1 35 covalent DOUB C24 O43 ? bmse010143 1 36 covalent SING C24 O51 ? bmse010143 1 37 covalent DOUB C25 O44 ? bmse010143 1 38 covalent SING C25 O52 ? bmse010143 1 39 covalent DOUB C26 O45 ? bmse010143 1 40 covalent SING C26 O53 ? bmse010143 1 41 covalent SING C28 C38 ? bmse010143 1 42 covalent SING C29 C39 ? bmse010143 1 43 covalent SING C30 C31 ? bmse010143 1 44 covalent DOUB C30 C40 ? bmse010143 1 45 covalent SING C31 C38 ? bmse010143 1 46 covalent DOUB C32 C34 ? bmse010143 1 47 covalent SING C32 O52 ? bmse010143 1 48 covalent DOUB C33 C35 ? bmse010143 1 49 covalent SING C33 O54 ? bmse010143 1 50 covalent SING C34 O46 ? bmse010143 1 51 covalent SING C35 O47 ? bmse010143 1 52 covalent SING C36 C40 ? bmse010143 1 53 covalent SING C36 O48 ? bmse010143 1 54 covalent SING C37 C39 ? bmse010143 1 55 covalent SING C37 O54 ? bmse010143 1 56 covalent SING C38 O55 ? bmse010143 1 57 covalent SING C39 O53 ? bmse010143 1 58 covalent SING C40 O55 ? bmse010143 1 59 covalent SING C1 H56 ? bmse010143 1 60 covalent SING C1 H57 ? bmse010143 1 61 covalent SING C1 H58 ? bmse010143 1 62 covalent SING C2 H59 ? bmse010143 1 63 covalent SING C2 H60 ? bmse010143 1 64 covalent SING C2 H61 ? bmse010143 1 65 covalent SING C3 H62 ? bmse010143 1 66 covalent SING C3 H63 ? bmse010143 1 67 covalent SING C3 H64 ? bmse010143 1 68 covalent SING C4 H65 ? bmse010143 1 69 covalent SING C4 H66 ? bmse010143 1 70 covalent SING C4 H67 ? bmse010143 1 71 covalent SING C5 H68 ? bmse010143 1 72 covalent SING C5 H69 ? bmse010143 1 73 covalent SING C5 H70 ? bmse010143 1 74 covalent SING C6 H71 ? bmse010143 1 75 covalent SING C6 H72 ? bmse010143 1 76 covalent SING C6 H73 ? bmse010143 1 77 covalent SING C7 H74 ? bmse010143 1 78 covalent SING C7 H75 ? bmse010143 1 79 covalent SING C7 H76 ? bmse010143 1 80 covalent SING C8 H77 ? bmse010143 1 81 covalent SING C8 H78 ? bmse010143 1 82 covalent SING C8 H79 ? bmse010143 1 83 covalent SING C9 H80 ? bmse010143 1 84 covalent SING C10 H81 ? bmse010143 1 85 covalent SING C11 H82 ? bmse010143 1 86 covalent SING C12 H83 ? bmse010143 1 87 covalent SING C13 H84 ? bmse010143 1 88 covalent SING C14 H85 ? bmse010143 1 89 covalent SING C15 H86 ? bmse010143 1 90 covalent SING C15 H87 ? bmse010143 1 91 covalent SING C16 H88 ? bmse010143 1 92 covalent SING C17 H89 ? bmse010143 1 93 covalent SING C18 H90 ? bmse010143 1 94 covalent SING C19 H91 ? bmse010143 1 95 covalent SING C20 H92 ? bmse010143 1 96 covalent SING C20 H93 ? bmse010143 1 97 covalent SING C21 H94 ? bmse010143 1 98 covalent SING C21 H95 ? bmse010143 1 99 covalent SING C31 H96 ? bmse010143 1 100 covalent SING C37 H97 ? bmse010143 1 101 covalent SING C38 H98 ? bmse010143 1 102 covalent SING C39 H99 ? bmse010143 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID no PubChem 111678013 sid ? "G-b-G-c-CA (acetate)" ? "matching entry" ? bmse010143 1 yes USDA_NMR_database 216 "Compound Number" ? "G-b-G-c-CA (acetate)" ? "matching entry" ? bmse010143 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010143 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010143 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "G-b-G-c-CA (acetate)" "natural abundance" 1 $G-b-G-c-CA-(acetate) ? Solute Saturated ? ? mg/ml ? "Sally Ralph" "G-b-G-c-CA (acetate)" n/a bmse010143 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010143 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010143 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "G-b-G-c-CA (acetate)" "natural abundance" 1 $G-b-G-c-CA-(acetate) ? Solute Saturated ? ? mg/ml ? "Sally Ralph" "G-b-G-c-CA (acetate)" n/a bmse010143 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010143 2 stop_ save_ save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010143 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 "G-b-G-c-CA (acetate)" "natural abundance" 1 $G-b-G-c-CA-(acetate) ? Solute Saturated ? ? mg/ml ? "Sally Ralph" "G-b-G-c-CA (acetate)" n/a bmse010143 3 2 DMSO "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010143 3 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010143 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010143 1 temperature 297 ? K bmse010143 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010143 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010143 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010143 1 stop_ save_ save_Bruker_250 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_250 _NMR_spectrometer.Entry_ID bmse010143 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model WM _NMR_spectrometer.Field_strength 250 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010143 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010143 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010143 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010143 1 4 "1D 13C" no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_250 ? ? bmse010143 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010143 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010143 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010143 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010143 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010143 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010143 2 stop_ save_ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010143 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 "residual solvent methyl proton" ppm 2.49 internal direct 1.000000000 ? ? ? bmse010143 3 C 13 DMSO-d6 "solvent methyl carbon" ppm 39.50 internal direct ? ? ? ? bmse010143 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010143 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010143 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010143 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C4 C 13 20.63 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 1 2 ? ? 1 1 ? 1 C5 C 13 20.74 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 1 3 ? ? 1 1 ? 1 C2 C 13 20.79 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 1 4 ? ? 1 1 ? 1 C1 C 13 20.96 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 1 5 ? ? 1 1 ? 1 C3 C 13 21.00 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 1 6 ? ? 1 1 ? 1 C31 C 13 50.37 ? ? 1 ? ? ? ? ? BB ? bmse010143 1 7 ? ? 1 1 ? 1 C6 C 13 55.88 ? ? 4 ? ? ? ? ? OMe ? bmse010143 1 8 ? ? 1 1 ? 1 C7 C 13 55.91 ? ? 4 ? ? ? ? ? OMe ? bmse010143 1 9 ? ? 1 1 ? 1 C8 C 13 56.00 ? ? 4 ? ? ? ? ? OMe ? bmse010143 1 10 ? ? 1 1 ? 1 C21 C 13 62.45 ? ? 1 ? ? ? ? ? G ? bmse010143 1 11 ? ? 1 1 ? 1 C15 C 13 65.18 ? ? 1 ? ? ? ? ? CG ? bmse010143 1 12 ? ? 1 1 ? 1 C20 C 13 65.29 ? ? 1 ? ? ? ? ? BG ? bmse010143 1 13 ? ? 1 1 ? 1 C39 C 13 73.66 ? ? 1 ? ? ? ? ? A ? bmse010143 1 14 ? ? 1 1 ? 1 C37 C 13 80.25 ? ? 1 ? ? ? ? ? B ? bmse010143 1 15 ? ? 1 1 ? 1 C38 C 13 88.23 ? ? 1 ? ? ? ? ? BA ? bmse010143 1 16 ? ? 1 1 ? 1 C18 C 13 110.28 ? ? 1 ? ? ? ? ? B2 ? bmse010143 1 17 ? ? 1 1 ? 1 C17 C 13 110.60 ? ? 1 ? ? ? ? ? C2 ? bmse010143 1 18 ? ? 1 1 ? 1 C19 C 13 111.88 ? ? 1 ? ? ? ? ? A2 ? bmse010143 1 19 ? ? 1 1 ? 1 C16 C 13 115.31 ? ? 1 ? ? ? ? ? C6 ? bmse010143 1 20 ? ? 1 1 ? 1 C11 C 13 118.69 ? ? 1 ? ? ? ? ? B6 ? bmse010143 1 21 ? ? 1 1 ? 1 C14 C 13 119.18 ? ? 1 ? ? ? ? ? B5 ? bmse010143 1 22 ? ? 1 1 ? 1 C12 C 13 119.60 ? ? 1 ? ? ? ? ? A6 ? bmse010143 1 23 ? ? 1 1 ? 1 C9 C 13 121.24 ? ? 1 ? ? ? ? ? CB ? bmse010143 1 24 ? ? 1 1 ? 1 C13 C 13 122.59 ? ? 1 ? ? ? ? ? A5 ? bmse010143 1 25 ? ? 1 1 ? 1 C30 C 13 127.49 ? ? 1 ? ? ? ? ? C5 ? bmse010143 1 26 ? ? 1 1 ? 1 C27 C 13 130.60 ? ? 1 ? ? ? ? ? C1 ? bmse010143 1 27 ? ? 1 1 ? 1 C10 C 13 134.30 ? ? 1 ? ? ? ? ? CA ? bmse010143 1 28 ? ? 1 1 ? 1 C29 C 13 135.30 ? ? 1 ? ? ? ? ? A1 ? bmse010143 1 29 ? ? 1 1 ? 1 C28 C 13 135.80 ? ? 1 ? ? ? ? ? B1 ? bmse010143 1 30 ? ? 1 1 ? 1 C32 C 13 139.75 ? ? 1 ? ? ? ? ? A4 ? bmse010143 1 31 ? ? 1 1 ? 1 C36 C 13 144.41 ? ? 1 ? ? ? ? ? C3 ? bmse010143 1 32 ? ? 1 1 ? 1 C33 C 13 147.19 ? ? 1 ? ? ? ? ? B4 ? bmse010143 1 33 ? ? 1 1 ? 1 C40 C 13 148.20 ? ? 1 ? ? ? ? ? C4 ? bmse010143 1 34 ? ? 1 1 ? 1 C35 C 13 150.96 ? ? 1 ? ? ? ? ? B3 ? bmse010143 1 35 ? ? 1 1 ? 1 C34 C 13 151.19 ? ? 1 ? ? ? ? ? A3 ? bmse010143 1 36 ? ? 1 1 ? 1 C25 C 13 168.80 ? ? 1 ? ? ? ? ? A4C=O ? bmse010143 1 37 ? ? 1 1 ? 1 C26 C 13 169.49 ? ? 1 ? ? ? ? ? AAC=O ? bmse010143 1 38 ? ? 1 1 ? 1 C22 C 13 170.74 ? ? 1 ? ? ? ? ? CGC=O ? bmse010143 1 39 ? ? 1 1 ? 1 C23 C 13 170.76 ? ? 1 ? ? ? ? ? BGC=O ? bmse010143 1 40 ? ? 1 1 ? 1 C24 C 13 170.88 ? ? 1 ? ? ? ? ? AGC=O ? bmse010143 1 stop_ loop_ _Ambiguous_atom_chem_shift.Ambiguous_shift_set_ID _Ambiguous_atom_chem_shift.Atom_chem_shift_ID _Ambiguous_atom_chem_shift.Entry_ID _Ambiguous_atom_chem_shift.Assigned_chem_shift_list_ID 1 7 bmse010143 1 1 8 bmse010143 1 1 9 bmse010143 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010143 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010143 2 3 "1D 13C" 2 $sample_2 bmse010143 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010143 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C4 C 13 20.45 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 2 2 ? ? 1 1 ? 1 C5 C 13 20.60 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 2 3 ? ? 1 1 ? 1 C2 C 13 20.68 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 2 4 ? ? 1 1 ? 1 C1 C 13 20.80 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 2 5 ? ? 1 1 ? 1 C3 C 13 20.86 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 2 6 ? ? 1 1 ? 1 C31 C 13 51.24 ? ? 1 ? ? ? ? ? BB ? bmse010143 2 7 ? ? 1 1 ? 1 C6 C 13 56.28 ? ? 1 ? ? ? ? ? OMe ? bmse010143 2 8 ? ? 1 1 ? 1 C7 C 13 56.28 ? ? 1 ? ? ? ? ? OMe ? bmse010143 2 9 ? ? 1 1 ? 1 C8 C 13 56.28 ? ? 1 ? ? ? ? ? OMe ? bmse010143 2 10 ? ? 1 1 ? 1 C21 C 13 63.04 ? ? 1 ? ? ? ? ? G ? bmse010143 2 11 ? ? 1 1 ? 1 C15 C 13 65.49 ? ? 1 ? ? ? ? ? CG ? bmse010143 2 12 ? ? 1 1 ? 1 C20 C 13 65.95 ? ? 1 ? ? ? ? ? BG ? bmse010143 2 13 ? ? 1 1 ? 1 C39 C 13 74.48 ? ? 1 ? ? ? ? ? A ? bmse010143 2 14 ? ? 1 1 ? 1 C37 C 13 80.30 ? ? 1 ? ? ? ? ? B ? bmse010143 2 15 ? ? 1 1 ? 1 C38 C 13 88.54 ? ? 1 ? ? ? ? ? BA ? bmse010143 2 16 ? ? 1 1 ? 1 C18 C 13 111.50 ? ? 1 ? ? ? ? ? B2 ? bmse010143 2 17 ? ? 1 1 ? 1 C17 C 13 112.17 ? ? 1 ? ? ? ? ? C2 ? bmse010143 2 18 ? ? 1 1 ? 1 C19 C 13 112.71 ? ? 1 ? ? ? ? ? A2 ? bmse010143 2 19 ? ? 1 1 ? 1 C16 C 13 116.33 ? ? 1 ? ? ? ? ? C6 ? bmse010143 2 20 ? ? 1 1 ? 1 C11 C 13 119.14 ? ? 1 ? ? ? ? ? B6 ? bmse010143 2 21 ? ? 1 1 ? 1 C14 C 13 119.41 ? ? 1 ? ? ? ? ? B5 ? bmse010143 2 22 ? ? 1 1 ? 1 C12 C 13 120.45 ? ? 1 ? ? ? ? ? A6 ? bmse010143 2 23 ? ? 1 1 ? 1 C9 C 13 122.23 ? ? 1 ? ? ? ? ? CB ? bmse010143 2 24 ? ? 1 1 ? 1 C13 C 13 123.33 ? ? 1 ? ? ? ? ? A5 ? bmse010143 2 25 ? ? 1 1 ? 1 C30 C 13 129.01 ? ? 1 ? ? ? ? ? C5 ? bmse010143 2 26 ? ? 1 1 ? 1 C27 C 13 131.53 ? ? 1 ? ? ? ? ? C1 ? bmse010143 2 27 ? ? 1 1 ? 1 C10 C 13 134.71 ? ? 1 ? ? ? ? ? CA ? bmse010143 2 28 ? ? 1 1 ? 1 C29 C 13 136.60 ? ? 1 ? ? ? ? ? A1 ? bmse010143 2 29 ? ? 1 1 ? 1 C28 C 13 137.06 ? ? 1 ? ? ? ? ? B1 ? bmse010143 2 30 ? ? 1 1 ? 1 C32 C 13 140.78 ? ? 1 ? ? ? ? ? A4 ? bmse010143 2 31 ? ? 1 1 ? 1 C36 C 13 145.39 ? ? 1 ? ? ? ? ? C3 ? bmse010143 2 32 ? ? 1 1 ? 1 C33 C 13 148.14 ? ? 1 ? ? ? ? ? B4 ? bmse010143 2 33 ? ? 1 1 ? 1 C40 C 13 149.31 ? ? 1 ? ? ? ? ? C4 ? bmse010143 2 34 ? ? 1 1 ? 1 C35 C 13 151.95 ? ? 1 ? ? ? ? ? B3 ? bmse010143 2 35 ? ? 1 1 ? 1 C34 C 13 152.08 ? ? 1 ? ? ? ? ? A3 ? bmse010143 2 36 ? ? 1 1 ? 1 C25 C 13 168.92 ? ? 1 ? ? ? ? ? A4C=O ? bmse010143 2 37 ? ? 1 1 ? 1 C26 C 13 169.89 ? ? 1 ? ? ? ? ? AAC=O ? bmse010143 2 38 ? ? 1 1 ? 1 C22 C 13 170.77 ? ? 1 ? ? ? ? ? CGC=O ? bmse010143 2 39 ? ? 1 1 ? 1 C23 C 13 170.95 ? ? 1 ? ? ? ? ? BGC=O ? bmse010143 2 40 ? ? 1 1 ? 1 C24 C 13 170.95 ? ? 1 ? ? ? ? ? AGC=O ? bmse010143 2 41 ? ? 1 1 ? 1 H56 H 1 1.93 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 2 42 ? ? 1 1 ? 1 H57 H 1 1.93 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 2 43 ? ? 1 1 ? 1 H58 H 1 1.93 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 2 44 ? ? 1 1 ? 1 H62 H 1 2.04 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 2 45 ? ? 1 1 ? 1 H63 H 1 2.04 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 2 46 ? ? 1 1 ? 1 H64 H 1 2.04 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 2 47 ? ? 1 1 ? 1 H59 H 1 2.04 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 2 48 ? ? 1 1 ? 1 H60 H 1 2.04 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 2 49 ? ? 1 1 ? 1 H61 H 1 2.04 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 2 50 ? ? 1 1 ? 1 H68 H 1 2.06 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 2 51 ? ? 1 1 ? 1 H69 H 1 2.06 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 2 52 ? ? 1 1 ? 1 H70 H 1 2.06 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 2 53 ? ? 1 1 ? 1 H65 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 2 54 ? ? 1 1 ? 1 H66 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 2 55 ? ? 1 1 ? 1 H67 H 1 2.21 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 2 56 ? ? 1 1 ? 1 H31 H 1 3.75 ? ? 1 ? ? ? ? ? BB ? bmse010143 2 57 ? ? 1 1 ? 1 H71 H 1 3.81 ? ? 1 ? ? ? ? ? AOMe ? bmse010143 2 58 ? ? 1 1 ? 1 H72 H 1 3.81 ? ? 1 ? ? ? ? ? AOMe ? bmse010143 2 59 ? ? 1 1 ? 1 H73 H 1 3.81 ? ? 1 ? ? ? ? ? AOMe ? bmse010143 2 60 ? ? 1 1 ? 1 H74 H 1 3.81 ? ? 1 ? ? ? ? ? BOMe ? bmse010143 2 61 ? ? 1 1 ? 1 H75 H 1 3.81 ? ? 1 ? ? ? ? ? BOMe ? bmse010143 2 62 ? ? 1 1 ? 1 H76 H 1 3.81 ? ? 1 ? ? ? ? ? BOMe ? bmse010143 2 63 ? ? 1 1 ? 1 H77 H 1 3.89 ? ? 1 ? ? ? ? ? COMe ? bmse010143 2 64 ? ? 1 1 ? 1 H78 H 1 3.89 ? ? 1 ? ? ? ? ? COMe ? bmse010143 2 65 ? ? 1 1 ? 1 H79 H 1 3.89 ? ? 1 ? ? ? ? ? COMe ? bmse010143 2 66 ? ? 1 1 ? 1 H94 H 1 4.22 ? ? 1 ? ? ? ? ? AG1 ? bmse010143 2 67 ? ? 1 1 ? 1 H95 H 1 4.36 ? ? 1 ? ? ? ? ? AG2 ? bmse010143 2 68 ? ? 1 1 ? 1 H92 H 1 4.32 ? ? 1 ? ? ? ? ? BG1 ? bmse010143 2 69 ? ? 1 1 ? 1 H93 H 1 4.43 ? ? 1 ? ? ? ? ? BG2 ? bmse010143 2 70 ? ? 1 1 ? 1 H86 H 1 4.65 ? ? 1 ? ? ? ? ? CG ? bmse010143 2 71 ? ? 1 1 ? 1 H87 H 1 4.65 ? ? 1 ? ? ? ? ? CG ? bmse010143 2 72 ? ? 1 1 ? 1 H97 H 1 4.86 ? ? 1 ? ? ? ? ? B ? bmse010143 2 73 ? ? 1 1 ? 1 H98 H 1 5.55 ? ? 1 ? ? ? ? ? BA ? bmse010143 2 74 ? ? 1 1 ? 1 H99 H 1 6.05 ? ? 1 ? ? ? ? ? A ? bmse010143 2 75 ? ? 1 1 ? 1 H80 H 1 6.23 ? ? 1 ? ? ? ? ? CB ? bmse010143 2 76 ? ? 1 1 ? 1 H81 H 1 6.64 ? ? 1 ? ? ? ? ? CA ? bmse010143 2 77 ? ? 1 1 ? 1 H82 H 1 6.91 ? ? 1 ? ? ? ? ? B6 ? bmse010143 2 78 ? ? 1 1 ? 1 H85 H 1 7.00 ? ? 1 ? ? ? ? ? B5 ? bmse010143 2 79 ? ? 1 1 ? 1 H90 H 1 7.07 ? ? 1 ? ? ? ? ? B2 ? bmse010143 2 80 ? ? 1 1 ? 1 H91 H 1 7.23 ? ? 1 ? ? ? ? ? A2 ? bmse010143 2 stop_ save_ save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010143 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 4 "1D 13C" 3 $sample_3 bmse010143 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010143 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? ? 1 1 ? 1 C4 C 13 20.32 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010143 3 2 ? ? 1 1 ? 1 C5 C 13 20.40 ? ? 1 ? ? ? ? ? AAAcMe ? bmse010143 3 3 ? ? 1 1 ? 1 C2 C 13 20.51 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010143 3 4 ? ? 1 1 ? 1 C1 C 13 20.62 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010143 3 5 ? ? 1 1 ? 1 C3 C 13 20.70 ? ? 1 ? ? ? ? ? AGAcMe ? bmse010143 3 6 ? ? 1 1 ? 1 C31 C 13 49.34 ? ? 1 ? ? ? ? ? BB ? bmse010143 3 7 ? ? 1 1 ? 1 C6 C 13 55.71 ? ? 1 ? ? ? ? ? OMe ? bmse010143 3 8 ? ? 1 1 ? 1 C7 C 13 55.71 ? ? 1 ? ? ? ? ? OMe ? bmse010143 3 9 ? ? 1 1 ? 1 C8 C 13 55.71 ? ? 1 ? ? ? ? ? OMe ? bmse010143 3 10 ? ? 1 1 ? 1 C21 C 13 61.85 ? ? 1 ? ? ? ? ? G ? bmse010143 3 11 ? ? 1 1 ? 1 C15 C 13 64.49 ? ? 1 ? ? ? ? ? CG ? bmse010143 3 12 ? ? 1 1 ? 1 C20 C 13 64.76 ? ? 1 ? ? ? ? ? BG ? bmse010143 3 13 ? ? 1 1 ? 1 C39 C 13 73.01 ? ? 1 ? ? ? ? ? A ? bmse010143 3 14 ? ? 1 1 ? 1 C37 C 13 78.30 ? ? 1 ? ? ? ? ? B ? bmse010143 3 15 ? ? 1 1 ? 1 C38 C 13 87.17 ? ? 1 ? ? ? ? ? BA ? bmse010143 3 16 ? ? 1 1 ? 1 C18 C 13 110.74 ? ? 1 ? ? ? ? ? B2 ? bmse010143 3 17 ? ? 1 1 ? 1 C17 C 13 110.93 ? ? 1 ? ? ? ? ? C2 ? bmse010143 3 18 ? ? 1 1 ? 1 C19 C 13 111.62 ? ? 1 ? ? ? ? ? A2 ? bmse010143 3 19 ? ? 1 1 ? 1 C16 C 13 115.26 ? ? 1 ? ? ? ? ? C6 ? bmse010143 3 20 ? ? 1 1 ? 1 C11 C 13 117.49 ? ? 1 ? ? ? ? ? B6 ? bmse010143 3 21 ? ? 1 1 ? 1 C14 C 13 118.30 ? ? 1 ? ? ? ? ? B5 ? bmse010143 3 22 ? ? 1 1 ? 1 C12 C 13 119.33 ? ? 1 ? ? ? ? ? A6 ? bmse010143 3 23 ? ? 1 1 ? 1 C9 C 13 121.34 ? ? 1 ? ? ? ? ? CB ? bmse010143 3 24 ? ? 1 1 ? 1 C13 C 13 122.50 ? ? 1 ? ? ? ? ? A5 ? bmse010143 3 25 ? ? 1 1 ? 1 C30 C 13 127.89 ? ? 1 ? ? ? ? ? C5 ? bmse010143 3 26 ? ? 1 1 ? 1 C27 C 13 130.04 ? ? 1 ? ? ? ? ? C1 ? bmse010143 3 27 ? ? 1 1 ? 1 C10 C 13 133.49 ? ? 1 ? ? ? ? ? CA ? bmse010143 3 28 ? ? 1 1 ? 1 C29 C 13 135.05 ? ? 1 ? ? ? ? ? A1 ? bmse010143 3 29 ? ? 1 1 ? 1 C28 C 13 135.26 ? ? 1 ? ? ? ? ? B1 ? bmse010143 3 30 ? ? 1 1 ? 1 C32 C 13 139.06 ? ? 1 ? ? ? ? ? A4 ? bmse010143 3 31 ? ? 1 1 ? 1 C36 C 13 143.84 ? ? 1 ? ? ? ? ? C3 ? bmse010143 3 32 ? ? 1 1 ? 1 C33 C 13 146.54 ? ? 1 ? ? ? ? ? B4 ? bmse010143 3 33 ? ? 1 1 ? 1 C40 C 13 147.53 ? ? 1 ? ? ? ? ? C4 ? bmse010143 3 34 ? ? 1 1 ? 1 C35 C 13 150.16 ? ? 1 ? ? ? ? ? B3 ? bmse010143 3 35 ? ? 1 1 ? 1 C34 C 13 150.54 ? ? 1 ? ? ? ? ? A3 ? bmse010143 3 36 ? ? 1 1 ? 1 C25 C 13 168.43 ? ? 1 ? ? ? ? ? A4C=O ? bmse010143 3 37 ? ? 1 1 ? 1 C26 C 13 169.26 ? ? 1 ? ? ? ? ? AAC=O ? bmse010143 3 38 ? ? 1 1 ? 1 C22 C 13 170.04 ? ? 1 ? ? ? ? ? CGC=O ? bmse010143 3 39 ? ? 1 1 ? 1 C23 C 13 170.15 ? ? 1 ? ? ? ? ? BGC=O ? bmse010143 3 40 ? ? 1 1 ? 1 C24 C 13 170.28 ? ? 1 ? ? ? ? ? AGC=O ? bmse010143 3 stop_ save_