data_bmse010298 save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010298 _Entry.Title lignin_cw_compound_2022 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2012-02-24 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.21 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_2022 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010298 2 Stephane Quideau ? ? bmse010298 3 John Ralph ? ? bmse010298 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 "NMR Database of Lignin and Cell Wall Model Compounds" "United States Department of Agriculture" USDA bmse010298 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010298 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID "13C chemical shifts" 114 bmse010298 "1H chemical shifts" 4 bmse010298 stop_ loop_ _Release.Release_number _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 2011-07-19 2009-05-26 original Author "Original spectra from USDA" bmse010298 2 2011-09-07 2011-09-07 update BMRB "Ensured correct reference IDs" bmse010298 3 2011-09-09 2011-09-09 update BMRB "Brought up to date with latest Dictionary" bmse010298 4 2011-12-08 2011-12-08 update BMRB ; Changing chemcomp name from Guaiacylglycerol-A,B-bis coniferyl ether acetate for database consistency ; bmse010298 5 2011-12-14 2011-12-14 update BMRB "Set Assembly.Name to match Chem_comp.name" bmse010298 6 2011-12-16 2011-12-16 update BMRB "Standardized solvent" bmse010298 7 2012-02-24 2012-02-24 update BMRB "Set Raw_data_flag to no, since there are no raw data" bmse010298 stop_ save_ save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010298 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010298 1 2 John Ralph ? ? ? bmse010298 1 3 Larry Landucci ? L. ? bmse010298 1 stop_ save_ save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010298 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_2022 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_2022 1 $lignin_cw_compound_2022 yes native no no ? ? ? bmse010298 1 stop_ save_ save_lignin_cw_compound_2022 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_2022 _Entity.Entry_ID bmse010298 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name 'Guaiacylglycerol-A,B-bis coniferyl ether acetate' _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010298 1 stop_ save_ save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010298 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_2022 . n/a "multiple natural sources" yes "not applicable" n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010298 1 stop_ save_ save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010298 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_2022 . "chemical synthesis" . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010298 1 stop_ save_ save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010298 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_2022 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InCHi_code ; InChI=1/C38H42O13/c1-24(39)46-18-8-10-28-12-15-32(34(20-28)43-5)50-37(23-48-26(3)41)38(30-14-17-31(49-27(4)42)36(22-30)45-7)51-33-16-13-29(21-35(33)44-6)11-9-19-47-25(2)40/h8-17,20-22,37-38H,18-19,23H2,1-7H3/b10-8+,11-9+/t37-,38+/m0/s1 ; _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C38 H42 O13' _Chem_comp.Formula_weight 706.73228 _Chem_comp.Formula_mono_iso_wt_nat 706.2625414355 _Chem_comp.Formula_mono_iso_wt_13C 744.3900252719 _Chem_comp.Formula_mono_iso_wt_15N 706.2625414355 _Chem_comp.Formula_mono_iso_wt_13C_15N 744.3900252719 _Chem_comp.Image_file_name standards/lignin_cw_compound_2022/lit/jr_2022.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name standards/lignin_cw_compound_2022/lit/jr_2022.mol _Chem_comp.Struct_file_format MDL _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details ? _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID "Guaiacylglycerol-A,B-bis coniferyl ether acetate" synonym bmse010298 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID "Guaiacylglycerol-A,B-bis coniferyl ether acetate" Beilstein bmse010298 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical ; CC(=O)OCC=CC1=CC(=C(C=C1)O[C@@H](COC(C)=O)[C@@H](C2=CC(=C(C=C2)OC(C)=O)OC)OC3=C(C=C(C=CCOC(C)=O)C=C3)OC)OC ; bmse010298 1 Isomeric ; CC(=O)OCC=CC1=CC(=C(C=C1)O[C@@H](COC(C)=O)[C@@H](C2=CC(=C(C=C2)OC(C)=O)OC)OC3=C(C=C(C=CCOC(C)=O)C=C3)OC)OC ; bmse010298 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 BGAcMe C ? ? ? ? 450.3704 196.7500 ? ? ? bmse010298 1 C2 CGAcMe C ? ? ? ? 99.6296 372.2500 ? ? ? bmse010298 1 C3 GAcMe C ? ? ? ? 263.3090 250.7500 ? ? ? bmse010298 1 C4 A4AcMe C ? ? ? ? 216.5423 7.7500 ? ? ? bmse010298 1 C5 B3OMe C ? ? ? ? 310.0730 115.7500 ? ? ? bmse010298 1 C6 C3OMe C ? ? ? ? 99.6296 210.2500 ? ? ? bmse010298 1 C7 A3OMe C ? ? ? ? 123.0116 88.7500 ? ? ? bmse010298 1 C8 BB C ? ? ? ? 356.8397 196.7500 ? ? ? bmse010298 1 C9 CB C ? ? ? ? 146.3963 291.2500 ? ? ? bmse010298 1 C10 BA C ? ? ? ? 333.4577 210.2500 ? ? ? bmse010298 1 C11 CA C ? ? ? ? 169.7783 277.7500 ? ? ? bmse010298 1 C12 B6 C ? ? ? ? 286.6910 210.2500 ? ? ? bmse010298 1 C13 C6 C ? ? ? ? 193.1603 237.2500 ? ? ? bmse010298 1 C14 A6 C ? ? ? ? 216.5423 115.7500 ? ? ? bmse010298 1 C15 B5 C ? ? ? ? 263.3090 196.7500 ? ? ? bmse010298 1 C16 C5 C ? ? ? ? 193.1603 210.2500 ? ? ? bmse010298 1 C17 A5 C ? ? ? ? 216.5423 88.7500 ? ? ? bmse010298 1 C18 BG C ? ? ? ? 380.2217 210.2500 ? ? ? bmse010298 1 C19 CG C ? ? ? ? 146.3963 318.2500 ? ? ? bmse010298 1 C20 B2 C ? ? ? ? 310.0730 169.7500 ? ? ? bmse010298 1 C21 C2 C ? ? ? ? 146.3963 237.2500 ? ? ? bmse010298 1 C22 A2 C ? ? ? ? 169.7783 115.7500 ? ? ? bmse010298 1 C23 G C ? ? ? ? 216.5423 196.7500 ? ? ? bmse010298 1 C24 DGAcC=O C ? ? ? ? 426.9884 210.2500 ? ? ? bmse010298 1 C25 CGAcC=O C ? ? ? ? 123.0116 358.7500 ? ? ? bmse010298 1 C26 AGAcC=O C ? ? ? ? 239.9270 237.2500 ? ? ? bmse010298 1 C27 A4AcC=O C ? ? ? ? 216.5423 34.7500 ? ? ? bmse010298 1 C28 B1 C ? ? ? ? 310.0730 196.7500 ? ? ? bmse010298 1 C29 C1 C ? ? ? ? 169.7783 250.7500 ? ? ? bmse010298 1 C30 A1 C ? ? ? ? 193.1603 129.2500 ? ? ? bmse010298 1 C31 A4 C ? ? ? ? 193.1603 75.2500 ? ? ? bmse010298 1 C32 B4 C ? ? ? ? 263.3090 169.7500 ? ? ? bmse010298 1 C33 C4 C ? ? ? ? 169.7783 196.7500 ? ? ? bmse010298 1 C34 B3 C ? ? ? ? 286.6910 156.2500 ? ? ? bmse010298 1 C35 C3 C ? ? ? ? 146.3963 210.2500 ? ? ? bmse010298 1 C36 A3 C ? ? ? ? 169.7783 88.7500 ? ? ? bmse010298 1 C37 B C ? ? ? ? 216.5423 169.7500 ? ? ? bmse010298 1 C38 A C ? ? ? ? 193.1603 156.2500 ? ? ? bmse010298 1 O39 ? O ? ? ? ? 426.9884 237.2500 ? ? ? bmse010298 1 O40 ? O ? ? ? ? 146.3963 372.2500 ? ? ? bmse010298 1 O41 ? O ? ? ? ? 216.5423 250.7500 ? ? ? bmse010298 1 O42 ? O ? ? ? ? 239.9270 48.2500 ? ? ? bmse010298 1 O43 ? O ? ? ? ? 286.6910 129.2500 ? ? ? bmse010298 1 O44 ? O ? ? ? ? 123.0116 196.7500 ? ? ? bmse010298 1 O45 ? O ? ? ? ? 146.3963 75.2500 ? ? ? bmse010298 1 O46 ? O ? ? ? ? 403.6037 196.7500 ? ? ? bmse010298 1 O47 ? O ? ? ? ? 123.0116 331.7500 ? ? ? bmse010298 1 O48 ? O ? ? ? ? 239.9270 210.2500 ? ? ? bmse010298 1 O49 ? O ? ? ? ? 193.1603 48.2500 ? ? ? bmse010298 1 O50 ? O ? ? ? ? 239.9270 156.2500 ? ? ? bmse010298 1 O51 ? O ? ? ? ? 169.7783 169.7500 ? ? ? bmse010298 1 H52 ? H ? ? ? ? 442.0002 182.2528 ? ? ? bmse010298 1 H53 ? H ? ? ? ? 464.8676 188.3798 ? ? ? bmse010298 1 H54 ? H ? ? ? ? 458.7406 211.2472 ? ? ? bmse010298 1 H55 ? H ? ? ? ? 107.9998 386.7472 ? ? ? bmse010298 1 H56 ? H ? ? ? ? 85.1324 380.6202 ? ? ? bmse010298 1 H57 ? H ? ? ? ? 91.2594 357.7528 ? ? ? bmse010298 1 H58 ? H ? ? ? ? 271.6792 236.2528 ? ? ? bmse010298 1 H59 ? H ? ? ? ? 277.8062 259.1202 ? ? ? bmse010298 1 H60 ? H ? ? ? ? 254.9388 265.2472 ? ? ? bmse010298 1 H61 ? H ? ? ? ? 199.8023 7.7500 ? ? ? bmse010298 1 H62 ? H ? ? ? ? 216.5423 -8.9900 ? ? ? bmse010298 1 H63 ? H ? ? ? ? 233.2823 7.7500 ? ? ? bmse010298 1 H64 ? H ? ? ? ? 301.7028 101.2528 ? ? ? bmse010298 1 H65 ? H ? ? ? ? 324.5702 107.3798 ? ? ? bmse010298 1 H66 ? H ? ? ? ? 318.4432 130.2472 ? ? ? bmse010298 1 H67 ? H ? ? ? ? 107.9998 224.7472 ? ? ? bmse010298 1 H68 ? H ? ? ? ? 85.1324 218.6202 ? ? ? bmse010298 1 H69 ? H ? ? ? ? 91.2594 195.7528 ? ? ? bmse010298 1 H70 ? H ? ? ? ? 131.3811 103.2476 ? ? ? bmse010298 1 H71 ? H ? ? ? ? 108.5140 97.1195 ? ? ? bmse010298 1 H72 ? H ? ? ? ? 114.6421 74.2524 ? ? ? bmse010298 1 H73 ? H ? ? ? ? 356.8397 180.0100 ? ? ? bmse010298 1 H74 ? H ? ? ? ? 131.8990 282.8801 ? ? ? bmse010298 1 H75 ? H ? ? ? ? 333.4581 226.9900 ? ? ? bmse010298 1 H76 ? H ? ? ? ? 184.2756 286.1199 ? ? ? bmse010298 1 H77 ? H ? ? ? ? 286.6910 226.9900 ? ? ? bmse010298 1 H78 ? H ? ? ? ? 207.6576 245.6199 ? ? ? bmse010298 1 H79 ? H ? ? ? ? 231.0396 124.1199 ? ? ? bmse010298 1 H80 ? H ? ? ? ? 248.8117 205.1199 ? ? ? bmse010298 1 H81 ? H ? ? ? ? 207.6576 201.8801 ? ? ? bmse010298 1 H82 ? H ? ? ? ? 231.0396 80.3801 ? ? ? bmse010298 1 H83 ? H ? ? ? ? 390.9820 223.0735 ? ? ? bmse010298 1 H84 ? H ? ? ? ? 369.4614 223.0735 ? ? ? bmse010298 1 H85 ? H ? ? ? ? 162.8820 315.3433 ? ? ? bmse010298 1 H86 ? H ? ? ? ? 152.1213 333.9806 ? ? ? bmse010298 1 H87 ? H ? ? ? ? 324.5703 161.3801 ? ? ? bmse010298 1 H88 ? H ? ? ? ? 131.8990 245.6199 ? ? ? bmse010298 1 H89 ? H ? ? ? ? 155.2810 124.1199 ? ? ? bmse010298 1 H90 AG1 H ? ? ? ? 210.8173 212.4806 ? ? ? bmse010298 1 H91 AG2 H ? ? ? ? 200.0566 193.8433 ? ? ? bmse010298 1 H92 AB H ? ? ? ? 216.5427 153.0100 ? ? ? bmse010298 1 H93 AA H ? ? ? ? 178.6630 147.8801 ? ? ? bmse010298 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010298 1 C2 C2 BMRB bmse010298 1 C3 C3 BMRB bmse010298 1 C4 C4 BMRB bmse010298 1 C5 C5 BMRB bmse010298 1 C6 C6 BMRB bmse010298 1 C7 C7 BMRB bmse010298 1 C8 C8 BMRB bmse010298 1 C9 C9 BMRB bmse010298 1 C10 C10 BMRB bmse010298 1 C11 C11 BMRB bmse010298 1 C12 C12 BMRB bmse010298 1 C13 C13 BMRB bmse010298 1 C14 C14 BMRB bmse010298 1 C15 C15 BMRB bmse010298 1 C16 C16 BMRB bmse010298 1 C17 C17 BMRB bmse010298 1 C18 C18 BMRB bmse010298 1 C19 C19 BMRB bmse010298 1 C20 C20 BMRB bmse010298 1 C21 C21 BMRB bmse010298 1 C22 C22 BMRB bmse010298 1 C23 C23 BMRB bmse010298 1 C24 C24 BMRB bmse010298 1 C25 C25 BMRB bmse010298 1 C26 C26 BMRB bmse010298 1 C27 C27 BMRB bmse010298 1 C28 C28 BMRB bmse010298 1 C29 C29 BMRB bmse010298 1 C30 C30 BMRB bmse010298 1 C31 C31 BMRB bmse010298 1 C32 C32 BMRB bmse010298 1 C33 C33 BMRB bmse010298 1 C34 C34 BMRB bmse010298 1 C35 C35 BMRB bmse010298 1 C36 C36 BMRB bmse010298 1 C37 C37 BMRB bmse010298 1 C38 C38 BMRB bmse010298 1 O39 O39 BMRB bmse010298 1 O40 O40 BMRB bmse010298 1 O41 O41 BMRB bmse010298 1 O42 O42 BMRB bmse010298 1 O43 O43 BMRB bmse010298 1 O44 O44 BMRB bmse010298 1 O45 O45 BMRB bmse010298 1 O46 O46 BMRB bmse010298 1 O47 O47 BMRB bmse010298 1 O48 O48 BMRB bmse010298 1 O49 O49 BMRB bmse010298 1 O50 O50 BMRB bmse010298 1 O51 O51 BMRB bmse010298 1 H52 H52 BMRB bmse010298 1 H53 H53 BMRB bmse010298 1 H54 H54 BMRB bmse010298 1 H55 H55 BMRB bmse010298 1 H56 H56 BMRB bmse010298 1 H57 H57 BMRB bmse010298 1 H58 H58 BMRB bmse010298 1 H59 H59 BMRB bmse010298 1 H60 H60 BMRB bmse010298 1 H61 H61 BMRB bmse010298 1 H62 H62 BMRB bmse010298 1 H63 H63 BMRB bmse010298 1 H64 H64 BMRB bmse010298 1 H65 H65 BMRB bmse010298 1 H66 H66 BMRB bmse010298 1 H67 H67 BMRB bmse010298 1 H68 H68 BMRB bmse010298 1 H69 H69 BMRB bmse010298 1 H70 H70 BMRB bmse010298 1 H71 H71 BMRB bmse010298 1 H72 H72 BMRB bmse010298 1 H73 H73 BMRB bmse010298 1 H74 H74 BMRB bmse010298 1 H75 H75 BMRB bmse010298 1 H76 H76 BMRB bmse010298 1 H77 H77 BMRB bmse010298 1 H78 H78 BMRB bmse010298 1 H79 H79 BMRB bmse010298 1 H80 H80 BMRB bmse010298 1 H81 H81 BMRB bmse010298 1 H82 H82 BMRB bmse010298 1 H83 H83 BMRB bmse010298 1 H84 H84 BMRB bmse010298 1 H85 H85 BMRB bmse010298 1 H86 H86 BMRB bmse010298 1 H87 H87 BMRB bmse010298 1 H88 H88 BMRB bmse010298 1 H89 H89 BMRB bmse010298 1 H90 H90 BMRB bmse010298 1 H91 H91 BMRB bmse010298 1 H92 H92 BMRB bmse010298 1 H93 H93 BMRB bmse010298 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C24 ? bmse010298 1 2 covalent SING C2 C25 ? bmse010298 1 3 covalent SING C3 C26 ? bmse010298 1 4 covalent SING C4 C27 ? bmse010298 1 5 covalent SING C5 O43 ? bmse010298 1 6 covalent SING C6 O44 ? bmse010298 1 7 covalent SING C7 O45 ? bmse010298 1 8 covalent DOUB C8 C10 ? bmse010298 1 9 covalent SING C8 C18 ? bmse010298 1 10 covalent DOUB C9 C11 ? bmse010298 1 11 covalent SING C9 C19 ? bmse010298 1 12 covalent SING C10 C28 ? bmse010298 1 13 covalent SING C11 C29 ? bmse010298 1 14 covalent DOUB C12 C15 ? bmse010298 1 15 covalent SING C12 C28 ? bmse010298 1 16 covalent DOUB C13 C16 ? bmse010298 1 17 covalent SING C13 C29 ? bmse010298 1 18 covalent DOUB C14 C17 ? bmse010298 1 19 covalent SING C14 C30 ? bmse010298 1 20 covalent SING C15 C32 ? bmse010298 1 21 covalent SING C16 C33 ? bmse010298 1 22 covalent SING C17 C31 ? bmse010298 1 23 covalent SING C18 O46 ? bmse010298 1 24 covalent SING C19 O47 ? bmse010298 1 25 covalent DOUB C20 C28 ? bmse010298 1 26 covalent SING C20 C34 ? bmse010298 1 27 covalent DOUB C21 C29 ? bmse010298 1 28 covalent SING C21 C35 ? bmse010298 1 29 covalent DOUB C22 C30 ? bmse010298 1 30 covalent SING C22 C36 ? bmse010298 1 31 covalent SING C23 C37 ? bmse010298 1 32 covalent SING C23 O48 ? bmse010298 1 33 covalent DOUB C24 O39 ? bmse010298 1 34 covalent SING C24 O46 ? bmse010298 1 35 covalent DOUB C25 O40 ? bmse010298 1 36 covalent SING C25 O47 ? bmse010298 1 37 covalent DOUB C26 O41 ? bmse010298 1 38 covalent SING C26 O48 ? bmse010298 1 39 covalent DOUB C27 O42 ? bmse010298 1 40 covalent SING C27 O49 ? bmse010298 1 41 covalent SING C30 C38 ? bmse010298 1 42 covalent DOUB C31 C36 ? bmse010298 1 43 covalent SING C31 O49 ? bmse010298 1 44 covalent DOUB C32 C34 ? bmse010298 1 45 covalent SING C32 O50 ? bmse010298 1 46 covalent DOUB C33 C35 ? bmse010298 1 47 covalent SING C33 O51 ? bmse010298 1 48 covalent SING C34 O43 ? bmse010298 1 49 covalent SING C35 O44 ? bmse010298 1 50 covalent SING C36 O45 ? bmse010298 1 51 covalent SING C37 C38 ? bmse010298 1 52 covalent SING C37 O50 ? bmse010298 1 53 covalent SING C38 O51 ? bmse010298 1 54 covalent SING C1 H52 ? bmse010298 1 55 covalent SING C1 H53 ? bmse010298 1 56 covalent SING C1 H54 ? bmse010298 1 57 covalent SING C2 H55 ? bmse010298 1 58 covalent SING C2 H56 ? bmse010298 1 59 covalent SING C2 H57 ? bmse010298 1 60 covalent SING C3 H58 ? bmse010298 1 61 covalent SING C3 H59 ? bmse010298 1 62 covalent SING C3 H60 ? bmse010298 1 63 covalent SING C4 H61 ? bmse010298 1 64 covalent SING C4 H62 ? bmse010298 1 65 covalent SING C4 H63 ? bmse010298 1 66 covalent SING C5 H64 ? bmse010298 1 67 covalent SING C5 H65 ? bmse010298 1 68 covalent SING C5 H66 ? bmse010298 1 69 covalent SING C6 H67 ? bmse010298 1 70 covalent SING C6 H68 ? bmse010298 1 71 covalent SING C6 H69 ? bmse010298 1 72 covalent SING C7 H70 ? bmse010298 1 73 covalent SING C7 H71 ? bmse010298 1 74 covalent SING C7 H72 ? bmse010298 1 75 covalent SING C8 H73 ? bmse010298 1 76 covalent SING C9 H74 ? bmse010298 1 77 covalent SING C10 H75 ? bmse010298 1 78 covalent SING C11 H76 ? bmse010298 1 79 covalent SING C12 H77 ? bmse010298 1 80 covalent SING C13 H78 ? bmse010298 1 81 covalent SING C14 H79 ? bmse010298 1 82 covalent SING C15 H80 ? bmse010298 1 83 covalent SING C16 H81 ? bmse010298 1 84 covalent SING C17 H82 ? bmse010298 1 85 covalent SING C18 H83 ? bmse010298 1 86 covalent SING C18 H84 ? bmse010298 1 87 covalent SING C19 H85 ? bmse010298 1 88 covalent SING C19 H86 ? bmse010298 1 89 covalent SING C20 H87 ? bmse010298 1 90 covalent SING C21 H88 ? bmse010298 1 91 covalent SING C22 H89 ? bmse010298 1 92 covalent SING C23 H90 ? bmse010298 1 93 covalent SING C23 H91 ? bmse010298 1 94 covalent SING C37 H92 ? bmse010298 1 95 covalent SING C38 H93 ? bmse010298 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 2022 "Compound Number" ? lignin_cw_compound_2022 ? "matching entry" ? bmse010298 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010298 1 stop_ save_ save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010298 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2022 "natural abundance" 1 $lignin_cw_compound_2022 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis coniferyl ether acetate" n/a bmse010298 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010298 1 stop_ save_ save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010298 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2022 "natural abundance" 1 $lignin_cw_compound_2022 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis coniferyl ether acetate" n/a bmse010298 2 2 acetone "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010298 2 stop_ save_ save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010298 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_2022 "natural abundance" 1 $lignin_cw_compound_2022 ? Solute Saturated ? ? 1 ? "Stephane Quideau" "Guaiacylglycerol-A,B-bis coniferyl ether acetate" n/a bmse010298 3 2 DMSO "100% deuterated" 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010298 3 stop_ save_ save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010298 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010298 1 temperature 297 ? K bmse010298 1 stop_ save_ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010298 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010298 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010298 1 stop_ save_ save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010298 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010298 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 "1D 13C" no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010298 1 2 "1D 1H" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010298 1 3 "1D 13C" no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010298 1 4 "1D 13C" no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010298 1 stop_ save_ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010298 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 "residual solvent proton" ppm 7.24 internal direct 1.000000000 ? ? ? bmse010298 1 C 13 CDCl3 "solvent carbon" ppm 77.00 internal direct ? ? ? ? bmse010298 1 stop_ save_ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010298 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 "residual solvent methyl proton" ppm 2.04 internal direct 1.000000000 ? ? ? bmse010298 2 C 13 Acetone-d6 "solvent methyl carbon" ppm 29.83 internal direct ? ? ? ? bmse010298 2 stop_ save_ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010298 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 "residual solvent methyl proton" ppm 2.49 internal direct 1.000000000 ? ? ? bmse010298 3 C 13 DMSO-d6 "solvent methyl carbon" ppm 39.50 internal direct ? ? ? ? bmse010298 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # Index Value Definition # # # # 1 Unique (geminal atoms and geminal methyl # # groups with identical chemical shifts # # are assumed to be assigned to # # stereospecific atoms) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. Tyr HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. Lys HG and # # HD protons or Trp HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (Lys 12 vs. Lys 27) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010298 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 "1D 13C" 1 $sample_1 bmse010298 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010298 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C4 C 13 20.63 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010298 1 2 ? 1 1 1 1 1 C3 C 13 20.73 ? ? 1 ? ? ? ? ? GAcMe ? bmse010298 1 3 ? 1 1 1 1 1 C2 C 13 20.98 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010298 1 4 ? 1 1 1 1 1 C1 C 13 20.98 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010298 1 5 ? 1 1 1 1 1 C7 C 13 55.73 ? ? 1 ? ? ? ? ? A3OMe ? bmse010298 1 6 ? 1 1 1 1 1 C5 C 13 55.91 ? ? 1 ? ? ? ? ? B3OMe ? bmse010298 1 7 ? 1 1 1 1 1 C6 C 13 55.94 ? ? 1 ? ? ? ? ? C3OMe ? bmse010298 1 8 ? 1 1 1 1 1 C23 C 13 63.37 ? ? 1 ? ? ? ? ? G ? bmse010298 1 9 ? 1 1 1 1 1 C19 C 13 65.08 ? ? 1 ? ? ? ? ? CG ? bmse010298 1 10 ? 1 1 1 1 1 C18 C 13 65.12 ? ? 1 ? ? ? ? ? BG ? bmse010298 1 11 ? 1 1 1 1 1 C38 C 13 80.17 ? ? 1 ? ? ? ? ? A ? bmse010298 1 12 ? 1 1 1 1 1 C37 C 13 81.92 ? ? 1 ? ? ? ? ? B ? bmse010298 1 13 ? 1 1 1 1 1 C21 C 13 109.94 ? ? 1 ? ? ? ? ? C2 ? bmse010298 1 14 ? 1 1 1 1 1 C20 C 13 110.11 ? ? 1 ? ? ? ? ? B2 ? bmse010298 1 15 ? 1 1 1 1 1 C22 C 13 111.29 ? ? 1 ? ? ? ? ? A2 ? bmse010298 1 16 ? 1 1 1 1 1 C16 C 13 116.41 ? ? 1 ? ? ? ? ? C5 ? bmse010298 1 17 ? 1 1 1 1 1 C15 C 13 118.92 ? ? 1 ? ? ? ? ? B5 ? bmse010298 1 18 ? 1 1 1 1 1 C13 C 13 119.49 ? ? 1 ? ? ? ? ? C6 ? bmse010298 1 19 ? 1 1 1 1 1 C12 C 13 119.77 ? ? 1 ? ? ? ? ? B6 ? bmse010298 1 20 ? 1 1 1 1 1 C14 C 13 119.79 ? ? 1 ? ? ? ? ? A6 ? bmse010298 1 21 ? 1 1 1 1 1 C9 C 13 121.69 ? ? 1 ? ? ? ? ? CB ? bmse010298 1 22 ? 1 1 1 1 1 C8 C 13 122.03 ? ? 1 ? ? ? ? ? BB ? bmse010298 1 23 ? 1 1 1 1 1 C17 C 13 122.50 ? ? 1 ? ? ? ? ? A5 ? bmse010298 1 24 ? 1 1 1 1 1 C29 C 13 130.61 ? ? 1 ? ? ? ? ? C1 ? bmse010298 1 25 ? 1 1 1 1 1 C28 C 13 131.55 ? ? 1 ? ? ? ? ? B1 ? bmse010298 1 26 ? 1 1 1 1 1 C11 C 13 133.92 ? ? 1 ? ? ? ? ? CA ? bmse010298 1 27 ? 1 1 1 1 1 C10 C 13 134.02 ? ? 1 ? ? ? ? ? BA ? bmse010298 1 28 ? 1 1 1 1 1 C30 C 13 136.80 ? ? 1 ? ? ? ? ? A1 ? bmse010298 1 29 ? 1 1 1 1 1 C31 C 13 139.53 ? ? 1 ? ? ? ? ? A4 ? bmse010298 1 30 ? 1 1 1 1 1 C33 C 13 147.45 ? ? 1 ? ? ? ? ? C4 ? bmse010298 1 31 ? 1 1 1 1 1 C32 C 13 147.47 ? ? 1 ? ? ? ? ? B4 ? bmse010298 1 32 ? 1 1 1 1 1 C35 C 13 150.18 ? ? 1 ? ? ? ? ? C3 ? bmse010298 1 33 ? 1 1 1 1 1 C34 C 13 150.90 ? ? 1 ? ? ? ? ? B3 ? bmse010298 1 34 ? 1 1 1 1 1 C36 C 13 151.09 ? ? 1 ? ? ? ? ? A3 ? bmse010298 1 35 ? 1 1 1 1 1 C27 C 13 168.76 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010298 1 36 ? 1 1 1 1 1 C26 C 13 170.76 ? ? 1 ? ? ? ? ? AGAcC=O ? bmse010298 1 37 ? 1 1 1 1 1 C24 C 13 170.83 ? ? 1 ? ? ? ? ? DGAcC=O ? bmse010298 1 38 ? 1 1 1 1 1 C25 C 13 170.83 ? ? 1 ? ? ? ? ? CGAcC=O ? bmse010298 1 stop_ save_ save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010298 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 2 "1D 1H" 2 $sample_2 bmse010298 2 3 "1D 13C" 2 $sample_2 bmse010298 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010298 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C4 C 13 20.44 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010298 2 2 ? 1 1 1 1 1 C3 C 13 20.62 ? ? 1 ? ? ? ? ? GAcMe ? bmse010298 2 3 ? 1 1 1 1 1 C2 C 13 20.76 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010298 2 4 ? 1 1 1 1 1 C1 C 13 20.78 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010298 2 5 ? 1 1 1 1 1 C7 C 13 56.23 ? ? 1 ? ? ? ? ? A3OMe ? bmse010298 2 6 ? 1 1 1 1 1 C5 C 13 56.23 ? ? 1 ? ? ? ? ? B3OMe ? bmse010298 2 7 ? 1 1 1 1 1 C6 C 13 56.39 ? ? 1 ? ? ? ? ? C3OMe ? bmse010298 2 8 ? 1 1 1 1 1 C23 C 13 63.56 ? ? 1 ? ? ? ? ? G ? bmse010298 2 9 ? 1 1 1 1 1 C19 C 13 65.37 ? ? 1 ? ? ? ? ? CG ? bmse010298 2 10 ? 1 1 1 1 1 C18 C 13 65.37 ? ? 1 ? ? ? ? ? BG ? bmse010298 2 11 ? 1 1 1 1 1 C38 C 13 80.85 ? ? 1 ? ? ? ? ? A ? bmse010298 2 12 ? 1 1 1 1 1 C37 C 13 81.74 ? ? 1 ? ? ? ? ? B ? bmse010298 2 13 ? 1 1 1 1 1 C21 C 13 111.16 ? ? 1 ? ? ? ? ? C2 ? bmse010298 2 14 ? 1 1 1 1 1 C20 C 13 111.32 ? ? 1 ? ? ? ? ? B2 ? bmse010298 2 15 ? 1 1 1 1 1 C22 C 13 112.74 ? ? 1 ? ? ? ? ? A2 ? bmse010298 2 16 ? 1 1 1 1 1 C16 C 13 117.41 ? ? 1 ? ? ? ? ? C5 ? bmse010298 2 17 ? 1 1 1 1 1 C15 C 13 119.23 ? ? 1 ? ? ? ? ? B5 ? bmse010298 2 18 ? 1 1 1 1 1 C13 C 13 120.45 ? ? 1 ? ? ? ? ? C6 ? bmse010298 2 19 ? 1 1 1 1 1 C12 C 13 120.50 ? ? 1 ? ? ? ? ? B6 ? bmse010298 2 20 ? 1 1 1 1 1 C14 C 13 120.51 ? ? 1 ? ? ? ? ? A6 ? bmse010298 2 21 ? 1 1 1 1 1 C9 C 13 122.99 ? ? 1 ? ? ? ? ? CB ? bmse010298 2 22 ? 1 1 1 1 1 C8 C 13 123.18 ? ? 1 ? ? ? ? ? BB ? bmse010298 2 23 ? 1 1 1 1 1 C17 C 13 123.26 ? ? 1 ? ? ? ? ? A5 ? bmse010298 2 24 ? 1 1 1 1 1 C29 C 13 131.73 ? ? 1 ? ? ? ? ? C1 ? bmse010298 2 25 ? 1 1 1 1 1 C28 C 13 132.34 ? ? 1 ? ? ? ? ? B1 ? bmse010298 2 26 ? 1 1 1 1 1 C11 C 13 134.22 ? ? 1 ? ? ? ? ? CA ? bmse010298 2 27 ? 1 1 1 1 1 C10 C 13 134.22 ? ? 1 ? ? ? ? ? BA ? bmse010298 2 28 ? 1 1 1 1 1 C30 C 13 137.52 ? ? 1 ? ? ? ? ? A1 ? bmse010298 2 29 ? 1 1 1 1 1 C31 C 13 140.65 ? ? 1 ? ? ? ? ? A4 ? bmse010298 2 30 ? 1 1 1 1 1 C33 C 13 148.20 ? ? 1 ? ? ? ? ? C4 ? bmse010298 2 31 ? 1 1 1 1 1 C32 C 13 148.66 ? ? 1 ? ? ? ? ? B4 ? bmse010298 2 32 ? 1 1 1 1 1 C35 C 13 151.43 ? ? 1 ? ? ? ? ? C3 ? bmse010298 2 33 ? 1 1 1 1 1 C34 C 13 151.91 ? ? 1 ? ? ? ? ? B3 ? bmse010298 2 34 ? 1 1 1 1 1 C36 C 13 152.12 ? ? 1 ? ? ? ? ? A3 ? bmse010298 2 35 ? 1 1 1 1 1 C27 C 13 168.85 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010298 2 36 ? 1 1 1 1 1 C26 C 13 170.72 ? ? 1 ? ? ? ? ? AGAcC=O ? bmse010298 2 37 ? 1 1 1 1 1 C24 C 13 170.74 ? ? 1 ? ? ? ? ? DGAcC=O ? bmse010298 2 38 ? 1 1 1 1 1 C25 C 13 170.77 ? ? 1 ? ? ? ? ? CGAcC=O ? bmse010298 2 39 ? 1 1 1 1 1 H93 H 1 5.62 ? ? 1 ? ? ? ? ? AA ? bmse010298 2 40 ? 1 1 1 1 1 H92 H 1 4.87 ? ? 1 ? ? ? ? ? AB ? bmse010298 2 41 ? 1 1 1 1 1 H90 H 1 4.45 ? ? 1 ? ? ? ? ? AG1 ? bmse010298 2 42 ? 1 1 1 1 1 H91 H 1 4.53 ? ? 1 ? ? ? ? ? AG2 ? bmse010298 2 stop_ save_ save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010298 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 4 "1D 13C" 3 $sample_3 bmse010298 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010298 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C4 C 13 20.33 ? ? 1 ? ? ? ? ? A4AcMe ? bmse010298 3 2 ? 1 1 1 1 1 C3 C 13 20.42 ? ? 1 ? ? ? ? ? GAcMe ? bmse010298 3 3 ? 1 1 1 1 1 C2 C 13 20.70 ? ? 1 ? ? ? ? ? CGAcMe ? bmse010298 3 4 ? 1 1 1 1 1 C1 C 13 20.70 ? ? 1 ? ? ? ? ? BGAcMe ? bmse010298 3 5 ? 1 1 1 1 1 C7 C 13 55.59 ? ? 1 ? ? ? ? ? A3OMe ? bmse010298 3 6 ? 1 1 1 1 1 C5 C 13 55.64 ? ? 1 ? ? ? ? ? B3OMe ? bmse010298 3 7 ? 1 1 1 1 1 C6 C 13 55.78 ? ? 1 ? ? ? ? ? C3OMe ? bmse010298 3 8 ? 1 1 1 1 1 C23 C 13 62.39 ? ? 1 ? ? ? ? ? G ? bmse010298 3 9 ? 1 1 1 1 1 C19 C 13 64.39 ? ? 1 ? ? ? ? ? CG ? bmse010298 3 10 ? 1 1 1 1 1 C18 C 13 64.39 ? ? 1 ? ? ? ? ? BG ? bmse010298 3 11 ? 1 1 1 1 1 C38 C 13 78.68 ? ? 1 ? ? ? ? ? A ? bmse010298 3 12 ? 1 1 1 1 1 C37 C 13 79.56 ? ? 1 ? ? ? ? ? B ? bmse010298 3 13 ? 1 1 1 1 1 C21 C 13 110.15 ? ? 1 ? ? ? ? ? C2 ? bmse010298 3 14 ? 1 1 1 1 1 C20 C 13 110.21 ? ? 1 ? ? ? ? ? B2 ? bmse010298 3 15 ? 1 1 1 1 1 C22 C 13 111.87 ? ? 1 ? ? ? ? ? A2 ? bmse010298 3 16 ? 1 1 1 1 1 C16 C 13 115.81 ? ? 1 ? ? ? ? ? C5 ? bmse010298 3 17 ? 1 1 1 1 1 C15 C 13 117.06 ? ? 1 ? ? ? ? ? B5 ? bmse010298 3 18 ? 1 1 1 1 1 C13 C 13 119.43 ? ? 1 ? ? ? ? ? C6 ? bmse010298 3 19 ? 1 1 1 1 1 C12 C 13 119.48 ? ? 1 ? ? ? ? ? B6 ? bmse010298 3 20 ? 1 1 1 1 1 C14 C 13 119.50 ? ? 1 ? ? ? ? ? A6 ? bmse010298 3 21 ? 1 1 1 1 1 C9 C 13 122.12 ? ? 1 ? ? ? ? ? CB ? bmse010298 3 22 ? 1 1 1 1 1 C8 C 13 122.19 ? ? 1 ? ? ? ? ? BB ? bmse010298 3 23 ? 1 1 1 1 1 C17 C 13 122.38 ? ? 1 ? ? ? ? ? A5 ? bmse010298 3 24 ? 1 1 1 1 1 C29 C 13 130.12 ? ? 1 ? ? ? ? ? C1 ? bmse010298 3 25 ? 1 1 1 1 1 C28 C 13 130.51 ? ? 1 ? ? ? ? ? B1 ? bmse010298 3 26 ? 1 1 1 1 1 C11 C 13 133.00 ? ? 1 ? ? ? ? ? CA ? bmse010298 3 27 ? 1 1 1 1 1 C10 C 13 133.00 ? ? 1 ? ? ? ? ? BA ? bmse010298 3 28 ? 1 1 1 1 1 C30 C 13 136.19 ? ? 1 ? ? ? ? ? A1 ? bmse010298 3 29 ? 1 1 1 1 1 C31 C 13 138.88 ? ? 1 ? ? ? ? ? A4 ? bmse010298 3 30 ? 1 1 1 1 1 C33 C 13 146.38 ? ? 1 ? ? ? ? ? C4 ? bmse010298 3 31 ? 1 1 1 1 1 C32 C 13 146.99 ? ? 1 ? ? ? ? ? B4 ? bmse010298 3 32 ? 1 1 1 1 1 C35 C 13 149.75 ? ? 1 ? ? ? ? ? C3 ? bmse010298 3 33 ? 1 1 1 1 1 C34 C 13 150.09 ? ? 1 ? ? ? ? ? B3 ? bmse010298 3 34 ? 1 1 1 1 1 C36 C 13 150.45 ? ? 1 ? ? ? ? ? A3 ? bmse010298 3 35 ? 1 1 1 1 1 C27 C 13 168.34 ? ? 1 ? ? ? ? ? A4AcC=O ? bmse010298 3 36 ? 1 1 1 1 1 C26 C 13 170.07 ? ? 1 ? ? ? ? ? AGAcC=O ? bmse010298 3 37 ? 1 1 1 1 1 C24 C 13 170.10 ? ? 1 ? ? ? ? ? DGAcC=O ? bmse010298 3 38 ? 1 1 1 1 1 C25 C 13 170.12 ? ? 1 ? ? ? ? ? CGAcC=O ? bmse010298 3 stop_ save_